The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8,9-bis((1,5-dimethyl-1H-pyrazol-3-yl)methoxy)-4-ethyl-N-methyl-5,6-dihydrophenanthridine ID: ALA4850029
PubChem CID: 164611124
Max Phase: Preclinical
Molecular Formula: C28H33N5O2
Molecular Weight: 471.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cccc2c1N(C)Cc1cc(OCc3cnn(C)c3C)c(OCc3cc(C)n(C)n3)cc1-2
Standard InChI: InChI=1S/C28H33N5O2/c1-7-20-9-8-10-24-25-13-27(35-17-23-11-18(2)32(5)30-23)26(12-21(25)15-31(4)28(20)24)34-16-22-14-29-33(6)19(22)3/h8-14H,7,15-17H2,1-6H3
Standard InChI Key: DLVDFLNVTCSUPV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
5.4650 -13.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4639 -14.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1786 -14.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1768 -12.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8921 -13.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8910 -14.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6078 -14.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3305 -14.0642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6102 -12.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3308 -13.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0534 -12.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0567 -11.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3313 -11.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6117 -11.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0440 -14.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7504 -12.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7490 -14.4719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0349 -14.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7502 -11.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7663 -13.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4822 -12.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0357 -11.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3202 -14.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5721 -14.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0196 -14.7454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4316 -15.4602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2386 -15.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9538 -10.7651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1468 -10.5938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7345 -11.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2868 -11.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9140 -11.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8111 -9.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1993 -14.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4031 -13.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 1 0
1 16 1 0
2 17 1 0
17 18 1 0
16 19 1 0
11 20 1 0
20 21 1 0
19 22 1 0
18 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 2 0
27 23 1 0
22 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 22 1 0
30 32 1 0
29 33 1 0
25 34 1 0
24 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.61Molecular Weight (Monoisotopic): 471.2634AlogP: 5.11#Rotatable Bonds: 7Polar Surface Area: 57.34Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.16CX LogP: 4.91CX LogD: 4.91Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.81
References 1. Chen DZ, Fan SR, Yang BJ, Yao HC, Wang YT, Cai JY, Jing CX, Pan ZH, Luo M, Yuze YQ, Liu GJ, Hao XJ.. (2021) Phenanthridine Derivative Host Heat Shock Cognate 70 Down-Regulators as Porcine Epidemic Diarrhea Virus Inhibitors., 84 (4.0): [PMID:33760626 ] [10.1021/acs.jnatprod.0c01252 ]