10-(4-phenoxyphenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4850089

PubChem CID: 155088352

Max Phase: Preclinical

Molecular Formula: C28H21NO3

Molecular Weight: 419.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC2=C1C(c1ccc(Oc3ccccc3)cc1)C1=C(N2)c2ccccc2C1=O

Standard InChI:  InChI=1S/C28H21NO3/c30-23-12-6-11-22-25(23)24(26-27(29-22)20-9-4-5-10-21(20)28(26)31)17-13-15-19(16-14-17)32-18-7-2-1-3-8-18/h1-5,7-10,13-16,24,29H,6,11-12H2

Standard InChI Key:  BMCSDFNRCHRSFZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   33.1674   -4.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1663   -4.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8817   -5.4036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5989   -4.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5960   -4.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8799   -3.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8758   -2.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8766   -1.2784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5911   -1.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5910   -2.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2986   -2.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0111   -2.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0113   -1.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2989   -1.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1597   -2.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1575   -1.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3729   -2.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8843   -2.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3713   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0365   -0.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2152   -0.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7295   -1.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0669   -2.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1198   -3.5646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2973   -3.7494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8815   -6.2294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1663   -6.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4547   -6.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7399   -6.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7393   -7.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4594   -7.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1712   -7.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  1  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 17 24  2  0
 11 25  2  0
  3 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4850089

    ---

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.48Molecular Weight (Monoisotopic): 419.1521AlogP: 5.78#Rotatable Bonds: 3
Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.41CX LogD: 4.41
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -0.50

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source