4-Bromo-2-fluoro-N-(4-(N-phenylsulfamoyl)phenyl)benzamide

ID: ALA4850346

PubChem CID: 164615573

Max Phase: Preclinical

Molecular Formula: C19H14BrFN2O3S

Molecular Weight: 449.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1ccc(Br)cc1F

Standard InChI:  InChI=1S/C19H14BrFN2O3S/c20-13-6-11-17(18(21)12-13)19(24)22-14-7-9-16(10-8-14)27(25,26)23-15-4-2-1-3-5-15/h1-12,23H,(H,22,24)

Standard InChI Key:  KRDXCENPLJYGST-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   10.6730   -5.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0857   -6.3601    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.4942   -5.6477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5564   -7.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8473   -7.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1382   -7.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4333   -7.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4333   -8.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1382   -9.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8473   -8.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5564   -6.7684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2614   -7.9942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9705   -7.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6796   -7.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3845   -7.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3845   -6.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6796   -6.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9705   -6.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7933   -6.7767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7853   -7.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4903   -8.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4843   -8.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7732   -9.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0682   -8.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0742   -7.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1372   -6.7684    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7252   -9.2194    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  2  0
  4 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
  2 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 19 20  1  0
 16  2  1  0
 12 13  1  0
  6 26  1  0
  8 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4850346

    ---

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.30Molecular Weight (Monoisotopic): 447.9893AlogP: 4.64#Rotatable Bonds: 5
Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.94CX Basic pKa: CX LogP: 4.46CX LogD: 4.37
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.60Np Likeness Score: -1.98

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source