The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-acetyl-2-(5-(4-(2-chloroacetyl)piperazin-1-yl)pyridin-2-ylamino)-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7(8H)-one ID: ALA4850687
PubChem CID: 162424469
Max Phase: Preclinical
Molecular Formula: C26H30ClN7O3
Molecular Weight: 524.03
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1c(C)c2cnc(Nc3ccc(N4CCN(C(=O)CCl)CC4)cn3)nc2n(C2CCCC2)c1=O
Standard InChI: InChI=1S/C26H30ClN7O3/c1-16-20-15-29-26(31-24(20)34(18-5-3-4-6-18)25(37)23(16)17(2)35)30-21-8-7-19(14-28-21)32-9-11-33(12-10-32)22(36)13-27/h7-8,14-15,18H,3-6,9-13H2,1-2H3,(H,28,29,30,31)
Standard InChI Key: DHXAFRBSJGTAFK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
7.8128 -27.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8128 -28.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5181 -28.5769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5181 -26.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2234 -27.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2218 -28.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9260 -28.5779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6323 -28.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6300 -27.3525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9252 -26.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1057 -28.5821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5181 -26.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1039 -26.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1015 -26.1316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3974 -27.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5226 -29.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8622 -29.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1159 -30.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9331 -30.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1844 -29.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3404 -28.5789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0477 -28.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7542 -28.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4610 -28.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4606 -27.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7475 -26.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0436 -27.3566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1674 -26.9431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8760 -27.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1655 -26.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8722 -25.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5809 -26.1226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2876 -25.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5828 -26.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9963 -26.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7030 -25.7091 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.2857 -24.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 2 0
4 12 1 0
1 13 1 0
13 14 2 0
13 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
3 16 1 0
8 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
29 34 1 0
31 32 1 0
32 33 1 0
32 34 1 0
33 35 1 0
35 36 1 0
33 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.03Molecular Weight (Monoisotopic): 523.2099AlogP: 3.44#Rotatable Bonds: 6Polar Surface Area: 113.32Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.34CX Basic pKa: 3.53CX LogP: 2.92CX LogD: 2.92Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.24
References 1. Shan H, Ma X, Yan G, Luo M, Zhong X, Lan S, Yang J, Liu Y, Pu C, Tong Y, Li R.. (2021) Discovery of a novel covalent CDK4/6 inhibitor based on palbociclib scaffold., 219 [PMID:33857728 ] [10.1016/j.ejmech.2021.113432 ]