1-(4-fluoro-5-(4-methylpiperidin-1-yl)-2-nitrophenyl)-4-(phenylsulfonyl)piperazine

ID: ALA4851095

PubChem CID: 2885277

Max Phase: Preclinical

Molecular Formula: C22H27FN4O4S

Molecular Weight: 462.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1CCN(c2cc(N3CCN(S(=O)(=O)c4ccccc4)CC3)c([N+](=O)[O-])cc2F)CC1

Standard InChI:  InChI=1S/C22H27FN4O4S/c1-17-7-9-24(10-8-17)20-16-21(22(27(28)29)15-19(20)23)25-11-13-26(14-12-25)32(30,31)18-5-3-2-4-6-18/h2-6,15-17H,7-14H2,1H3

Standard InChI Key:  FCGVKUNPJHYYTC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   45.8235   -6.0909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.4151   -5.3785    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   45.0023   -6.0883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.1351   -2.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1340   -3.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8486   -4.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5650   -3.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5622   -2.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8468   -2.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4228   -4.1406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7089   -3.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9964   -4.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9914   -4.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7053   -5.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4241   -4.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4206   -2.4915    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   43.2800   -4.1419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2771   -4.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9880   -5.3781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7041   -4.9681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.7048   -4.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9893   -3.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2772   -2.4836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2740   -1.6587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9931   -2.8934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.1328   -4.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2751   -5.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8444   -5.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.5592   -4.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.5615   -4.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8430   -3.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1311   -4.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  5 10  1  0
  4 16  1  0
  7 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 23 24  2  0
 23 25  1  0
  8 23  1  0
 20  2  1  0
  2 26  1  0
 13 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
M  CHG  2  23   1  25  -1
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpr174 Probable G-protein coupled receptor 174 (140 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Splenocyte (1641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.1737AlogP: 3.48#Rotatable Bonds: 5
Polar Surface Area: 87.00Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.09CX LogD: 4.09
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.83

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source