(2S,3S)-3-((3,5-dichlorobenzyl)oxy)-1-((1-methyl-1H-pyrazol-4-yl)methyl)-2-phenylpiperidine

ID: ALA4851269

PubChem CID: 164611678

Max Phase: Preclinical

Molecular Formula: C23H25Cl2N3O

Molecular Weight: 430.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1cc(CN2CCC[C@H](OCc3cc(Cl)cc(Cl)c3)[C@@H]2c2ccccc2)cn1

Standard InChI:  InChI=1S/C23H25Cl2N3O/c1-27-14-18(13-26-27)15-28-9-5-8-22(23(28)19-6-3-2-4-7-19)29-16-17-10-20(24)12-21(25)11-17/h2-4,6-7,10-14,22-23H,5,8-9,15-16H2,1H3/t22-,23-/m0/s1

Standard InChI Key:  WNVPVQVCHAFYLX-GOTSBHOMSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   34.4954   -5.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4954   -5.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2007   -6.2280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9059   -5.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9059   -5.0063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2007   -4.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6148   -4.5998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6131   -6.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6087   -7.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3150   -7.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0243   -7.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0228   -6.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3160   -5.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6172   -3.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3261   -3.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0324   -3.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7408   -3.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7437   -2.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0322   -2.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3267   -2.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0317   -1.3376    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.4471   -3.7944    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.2007   -7.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4929   -7.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7422   -7.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1954   -7.7318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6040   -8.4395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4033   -8.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3826   -7.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  6
  4  8  1  6
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  7 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 17 22  1  0
  3 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 24  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4851269

    ---

Associated Targets(Human)

PRKG1 Tchem cGMP-dependent protein kinase 1 beta (2814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.38Molecular Weight (Monoisotopic): 429.1375AlogP: 5.65#Rotatable Bonds: 6
Polar Surface Area: 30.29Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.65CX LogP: 5.48CX LogD: 5.03
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: -1.20

References

1. Hanisak J, Soriano A, Adam GC, Basso A, Bauman D, Bell D, Frank E, O'Donnell G, Tawa P, Verras A, Yu Y, Zhang L, Seganish WM..  (2021)  Discovery of the First Non-cGMP Mimetic Small Molecule Activators of cGMP-Dependent Protein Kinase 1 α (PKG1α).,  12  (8.0): [PMID:34413956] [10.1021/acsmedchemlett.1c00264]

Source