4-(4-chloro-3-(4-methylpiperazine-1-carbonyl)benzylamino)quinazoline-6-carbonitrile

ID: ALA4851465

PubChem CID: 164617851

Max Phase: Preclinical

Molecular Formula: C22H21ClN6O

Molecular Weight: 420.90

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(C(=O)c2cc(CNc3ncnc4ccc(C#N)cc34)ccc2Cl)CC1

Standard InChI:  InChI=1S/C22H21ClN6O/c1-28-6-8-29(9-7-28)22(30)17-11-16(2-4-19(17)23)13-25-21-18-10-15(12-24)3-5-20(18)26-14-27-21/h2-5,10-11,14H,6-9,13H2,1H3,(H,25,26,27)

Standard InChI Key:  JSSYZKAZZDYQJE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   15.6697   -6.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6685   -7.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3766   -7.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3748   -5.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0834   -6.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0822   -7.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7884   -7.6191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5003   -7.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5015   -6.3914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7908   -5.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9624   -5.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2546   -5.5767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7908   -5.1607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4985   -4.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4985   -3.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2072   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2076   -2.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4994   -2.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7893   -2.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7924   -3.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4983   -1.4862    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.9155   -2.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6230   -2.7135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9159   -1.4873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6169   -3.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3204   -3.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0307   -3.5382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0331   -2.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3251   -2.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7366   -3.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  3  0
  1 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 17 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4851465

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1 (3927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.90Molecular Weight (Monoisotopic): 420.1465AlogP: 3.15#Rotatable Bonds: 4
Polar Surface Area: 85.15Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.76CX LogP: 2.82CX LogD: 2.73
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -1.89

References

1.  (2019)  Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer, 

Source