6-(4-fluorobenzyl)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol

ID: ALA4851736

PubChem CID: 164612814

Max Phase: Preclinical

Molecular Formula: C25H24FNO4

Molecular Weight: 421.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1O)CC1c3c(cc(OC)c(O)c3-2)CCN1Cc1ccc(F)cc1

Standard InChI:  InChI=1S/C25H24FNO4/c1-30-21-12-18-16(10-20(21)28)9-19-23-15(11-22(31-2)25(29)24(18)23)7-8-27(19)13-14-3-5-17(26)6-4-14/h3-6,10-12,19,28-29H,7-9,13H2,1-2H3

Standard InChI Key:  ODPDPRNSBUKAEJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   16.8170   -4.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8159   -5.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5222   -4.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2308   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6477   -5.4374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6488   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9381   -4.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2296   -5.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5244   -5.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9318   -6.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9342   -5.8385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2266   -7.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5281   -6.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8268   -7.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8228   -7.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5259   -8.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2243   -7.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1090   -5.8479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1092   -4.2099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1090   -3.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5251   -9.0852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1138   -8.2673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4074   -7.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3527   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0631   -5.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7644   -5.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4743   -5.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4800   -4.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7699   -4.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0630   -4.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1898   -4.2365    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  9  1  0
  4  3  2  0
  3  1  1  0
  4  8  1  0
  4  7  1  0
 11  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  2  0
  8 11  1  0
  9 13  1  0
 12 10  1  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  2 18  1  0
  1 19  1  0
 19 20  1  0
 16 21  1  0
 15 22  1  0
 22 23  1  0
  5 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4851736

    ---

Associated Targets(non-human)

EL4 (235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.47Molecular Weight (Monoisotopic): 421.1689AlogP: 4.58#Rotatable Bonds: 4
Polar Surface Area: 62.16Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.51CX Basic pKa: 6.20CX LogP: 4.65CX LogD: 4.62
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: 0.61

References

1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y..  (2021)  Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells.,  37  [PMID:33556569] [10.1016/j.bmcl.2021.127844]

Source