7-(4'-carbamimidoylbiphenyl-3-yl)-2-naphthimidamide

ID: ALA4851966

PubChem CID: 164611720

Max Phase: Preclinical

Molecular Formula: C24H20N4

Molecular Weight: 364.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)c1ccc(-c2cccc(-c3ccc4ccc(C(=N)N)cc4c3)c2)cc1

Standard InChI:  InChI=1S/C24H20N4/c25-23(26)17-8-4-15(5-9-17)18-2-1-3-19(12-18)20-10-6-16-7-11-21(24(27)28)14-22(16)13-20/h1-14H,(H3,25,26)(H3,27,28)

Standard InChI Key:  GJZFKOOVWIMVFW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   16.2512  -10.4005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2512  -11.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9702  -11.6403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5364  -11.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5364  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8216  -12.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1069  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3921  -12.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3921  -13.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6730  -14.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9583  -13.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9583  -12.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2435  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5286  -12.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8097  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0949  -12.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3801  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6652  -12.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9463  -12.4684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6652  -13.7082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3801  -11.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0949  -11.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8097  -11.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5286  -11.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2435  -11.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6730  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1069  -11.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8216  -11.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 17 21  1  0
 21 22  2  0
 15 23  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 13 25  1  0
 12 26  2  0
  8 26  1  0
  7 27  1  0
 27 28  2  0
  4 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4851966

    ---

Associated Targets(Human)

HOXA9 DNA binding site (122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.45Molecular Weight (Monoisotopic): 364.1688AlogP: 4.74#Rotatable Bonds: 4
Polar Surface Area: 99.74Molecular Species: BASEHBA: 2HBD: 4
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 11.69CX LogP: 4.10CX LogD: -0.71
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.31Np Likeness Score: -0.13

References

1. Depauw S, Lambert M, Jambon S, Paul A, Peixoto P, Nhili R, Marongiu L, Figeac M, Dassi C, Paul-Constant C, Billoré B, Kumar A, Farahat AA, Ismail MA, Mineva E, Sweat DP, Stephens CE, Boykin DW, Wilson WD, David-Cordonnier MH..  (2019)  Heterocyclic Diamidine DNA Ligands as HOXA9 Transcription Factor Inhibitors: Design, Molecular Evaluation, and Cellular Consequences in a HOXA9-Dependant Leukemia Cell Model.,  62  (3.0): [PMID:30645099] [10.1021/acs.jmedchem.8b01448]

Source