2-(3-Fluoro-2-hydroxyphenyl)-6-methyl-5-(2-methyl-1,3-thiazol-5-yl)-3-(2-phenylethyl)-4(3H)-pyrimidinone

ID: ALA4851971

PubChem CID: 136054358

Max Phase: Preclinical

Molecular Formula: C23H20FN3O2S

Molecular Weight: 421.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncc(-c2c(C)nc(-c3cccc(F)c3O)n(CCc3ccccc3)c2=O)s1

Standard InChI:  InChI=1S/C23H20FN3O2S/c1-14-20(19-13-25-15(2)30-19)23(29)27(12-11-16-7-4-3-5-8-16)22(26-14)17-9-6-10-18(24)21(17)28/h3-10,13,28H,11-12H2,1-2H3

Standard InChI Key:  CZDCIUAZFSKXPK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    4.2249  -11.5892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2237  -12.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9318  -12.8177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6414  -12.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6386  -11.5856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9300  -11.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3463  -12.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3462  -13.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0537  -14.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7618  -13.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7579  -12.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0498  -12.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5157  -12.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9275  -10.3632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5170  -11.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4314  -10.3689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6320  -10.1992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2235  -10.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7706  -11.5141    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4109  -10.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3448  -11.1744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0540  -11.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7602  -11.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4678  -11.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1735  -11.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1709  -10.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4567   -9.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7539  -10.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6387  -14.0423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0546  -14.8579    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  2 13  1  0
  6 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
  1 15  1  0
 18 20  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  8 29  1  0
  9 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4851971

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.50Molecular Weight (Monoisotopic): 421.1260AlogP: 4.74#Rotatable Bonds: 5
Polar Surface Area: 68.01Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.70CX Basic pKa: 0.75CX LogP: 4.21CX LogD: 4.03
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -0.95

References

1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW..  (2021)  Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction.,  12  (9.0): [PMID:34531948] [10.1021/acsmedchemlett.1c00187]

Source