The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3,5-difluoropyridin-2-yl)methyl)-2-(4-(8-methoxy-3,4-dihydroisoquinolin-2(1H)-yl)piperidin-1-yl)thiazole-5-carboxamide ID: ALA4852159
PubChem CID: 164617361
Max Phase: Preclinical
Molecular Formula: C25H27F2N5O2S
Molecular Weight: 499.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c1CN(C1CCN(c3ncc(C(=O)NCc4ncc(F)cc4F)s3)CC1)CC2
Standard InChI: InChI=1S/C25H27F2N5O2S/c1-34-22-4-2-3-16-5-8-32(15-19(16)22)18-6-9-31(10-7-18)25-30-14-23(35-25)24(33)29-13-21-20(27)11-17(26)12-28-21/h2-4,11-12,14,18H,5-10,13,15H2,1H3,(H,29,33)
Standard InChI Key: YBUVVPDQNUYGOE-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
15.3849 -13.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3837 -14.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0918 -14.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8015 -14.0014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7986 -13.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0900 -12.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0876 -11.9563 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.6757 -14.4099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.5048 -12.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2140 -13.1734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9202 -12.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6294 -13.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9171 -11.9450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7158 -13.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5157 -14.1472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9217 -13.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3725 -12.8327 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.7341 -13.3493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2173 -14.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0264 -13.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3599 -13.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8780 -12.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0627 -12.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1726 -13.0945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6496 -13.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4590 -13.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5003 -12.3516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3123 -12.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7909 -12.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6041 -12.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9398 -12.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4561 -11.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6445 -11.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1642 -10.8610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4966 -10.1144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
2 8 1 0
5 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 1 0
16 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 0
24 25 1 0
24 27 1 0
25 26 1 0
26 29 1 0
28 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.59Molecular Weight (Monoisotopic): 499.1854AlogP: 3.78#Rotatable Bonds: 6Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.88CX Basic pKa: 7.80CX LogP: 3.14CX LogD: 2.59Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.56Np Likeness Score: -1.37