N-((3,5-difluoropyridin-2-yl)methyl)-2-(4-(8-methoxy-3,4-dihydroisoquinolin-2(1H)-yl)piperidin-1-yl)thiazole-5-carboxamide

ID: ALA4852159

PubChem CID: 164617361

Max Phase: Preclinical

Molecular Formula: C25H27F2N5O2S

Molecular Weight: 499.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc2c1CN(C1CCN(c3ncc(C(=O)NCc4ncc(F)cc4F)s3)CC1)CC2

Standard InChI:  InChI=1S/C25H27F2N5O2S/c1-34-22-4-2-3-16-5-8-32(15-19(16)22)18-6-9-31(10-7-18)25-30-14-23(35-25)24(33)29-13-21-20(27)11-17(26)12-28-21/h2-4,11-12,14,18H,5-10,13,15H2,1H3,(H,29,33)

Standard InChI Key:  YBUVVPDQNUYGOE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   15.3849  -13.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3837  -14.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0918  -14.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8015  -14.0014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7986  -13.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0900  -12.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0876  -11.9563    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.6757  -14.4099    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.5048  -12.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2140  -13.1734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9202  -12.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6294  -13.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9171  -11.9450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7158  -13.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5157  -14.1472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9217  -13.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3725  -12.8327    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.7341  -13.3493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2173  -14.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0264  -13.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3599  -13.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8780  -12.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0627  -12.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1726  -13.0945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6496  -13.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4590  -13.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5003  -12.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3123  -12.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7909  -12.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6041  -12.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9398  -12.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4561  -11.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6445  -11.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1642  -10.8610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4966  -10.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  1  0
 16 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
 24 25  1  0
 24 27  1  0
 25 26  1  0
 26 29  1  0
 28 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4852159

    ---

Associated Targets(Human)

ADRA2C Tclin Alpha-2c adrenergic receptor (4876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.59Molecular Weight (Monoisotopic): 499.1854AlogP: 3.78#Rotatable Bonds: 6
Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.88CX Basic pKa: 7.80CX LogP: 3.14CX LogD: 2.59
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.56Np Likeness Score: -1.37

References

1. Sabnis RW..  (2021)  Novel Substituted Heterocyclic Carboxamides as Adrenoreceptor ADRAC2 Inhibitors for Treating Diseases.,  12  (9.0): [PMID:34531943] [10.1021/acsmedchemlett.1c00423]

Source