1-(1-(4-chlorobenzyl)-1H-indole-2-carbonyl)-N-(3-phenylpropyl)piperidine-4-carboxamide

ID: ALA4852348

PubChem CID: 164613954

Max Phase: Preclinical

Molecular Formula: C31H32ClN3O2

Molecular Weight: 514.07

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCc1ccccc1)C1CCN(C(=O)c2cc3ccccc3n2Cc2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C31H32ClN3O2/c32-27-14-12-24(13-15-27)22-35-28-11-5-4-10-26(28)21-29(35)31(37)34-19-16-25(17-20-34)30(36)33-18-6-9-23-7-2-1-3-8-23/h1-5,7-8,10-15,21,25H,6,9,16-20,22H2,(H,33,36)

Standard InChI Key:  JOBHQPKZXFMAPL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   29.0832   -1.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0820   -2.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7942   -2.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5080   -2.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5051   -1.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7924   -1.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2163   -2.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2176   -3.7194    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6359   -4.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8871   -4.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8145   -4.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5630   -4.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7646   -4.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2169   -4.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4731   -5.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2709   -5.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3712   -1.2548    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.6674   -3.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8344   -3.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2809   -4.4904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1095   -5.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7148   -5.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4968   -5.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6700   -4.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0571   -4.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1082   -6.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9382   -6.9366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8895   -5.8807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5009   -6.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2822   -6.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8936   -6.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6708   -6.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2804   -7.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0611   -6.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2317   -5.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6196   -5.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8412   -5.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8 12  1  0
 11  9  1  0
  9 10  2  0
 10  8  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  1 17  1  0
 10 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4852348

    ---

Associated Targets(non-human)

Western equine encephalitis virus (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.07Molecular Weight (Monoisotopic): 513.2183AlogP: 5.94#Rotatable Bonds: 8
Polar Surface Area: 54.34Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.79CX LogD: 5.79
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.44

References

1. Barraza SJ, Sindac JA, Dobry CJ, Delekta PC, Lee PH, Miller DJ, Larsen SD..  (2021)  Synthesis and biological activity of conformationally restricted indole-based inhibitors of neurotropic alphavirus replication: Generation of a three-dimensional pharmacophore.,  46  [PMID:34098081] [10.1016/j.bmcl.2021.128171]

Source