The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(2-fluorophenyl)acetamide ID: ALA4852878
PubChem CID: 164610118
Max Phase: Preclinical
Molecular Formula: C22H15FI2N4O4S2
Molecular Weight: 736.33
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccccc3F)nc3c(I)cc(I)cc3c2=O)cc1
Standard InChI: InChI=1S/C22H15FI2N4O4S2/c23-16-3-1-2-4-18(16)27-19(30)11-34-22-28-20-15(9-12(24)10-17(20)25)21(31)29(22)13-5-7-14(8-6-13)35(26,32)33/h1-10H,11H2,(H,27,30)(H2,26,32,33)
Standard InChI Key: HTCGSQAPQFGRFN-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
7.6436 -0.8997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0564 -1.6096 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4648 -0.8972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3841 -3.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3830 -4.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0910 -4.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0892 -2.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7979 -3.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7967 -4.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5068 -4.4686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2226 -4.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2238 -3.2342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5091 -2.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6763 -2.8273 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
3.0907 -5.2814 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
4.5092 -2.0011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9308 -2.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6378 -3.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3460 -2.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3484 -2.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6368 -1.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9314 -2.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9292 -4.4699 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.7639 -2.0192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6380 -4.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3446 -4.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0534 -4.0673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3423 -5.2911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7600 -4.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7529 -5.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4587 -5.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1685 -5.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1682 -4.4746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4619 -4.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4593 -3.2506 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
4 14 1 0
6 15 1 0
13 16 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
12 17 1 0
11 23 1 0
20 2 1 0
2 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 736.33Molecular Weight (Monoisotopic): 735.8608AlogP: 4.11#Rotatable Bonds: 6Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.11CX Basic pKa: ┄CX LogP: 5.24CX LogD: 5.24Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.34
References 1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM.. (2021) Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress., 42 [PMID:33811990 ] [10.1016/j.bmcl.2021.128002 ]