2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(2-fluorophenyl)acetamide

ID: ALA4852878

PubChem CID: 164610118

Max Phase: Preclinical

Molecular Formula: C22H15FI2N4O4S2

Molecular Weight: 736.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccccc3F)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C22H15FI2N4O4S2/c23-16-3-1-2-4-18(16)27-19(30)11-34-22-28-20-15(9-12(24)10-17(20)25)21(31)29(22)13-5-7-14(8-6-13)35(26,32)33/h1-10H,11H2,(H,27,30)(H2,26,32,33)

Standard InChI Key:  HTCGSQAPQFGRFN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    7.6436   -0.8997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0564   -1.6096    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4648   -0.8972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3841   -3.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3830   -4.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0910   -4.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0892   -2.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7979   -3.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7967   -4.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5068   -4.4686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2226   -4.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2238   -3.2342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5091   -2.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6763   -2.8273    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    3.0907   -5.2814    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    4.5092   -2.0011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9308   -2.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6378   -3.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3460   -2.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3484   -2.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6368   -1.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9314   -2.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9292   -4.4699    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.7639   -2.0192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6380   -4.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3446   -4.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0534   -4.0673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3423   -5.2911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7600   -4.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7529   -5.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4587   -5.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1685   -5.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1682   -4.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4619   -4.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4593   -3.2506    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4852878

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 736.33Molecular Weight (Monoisotopic): 735.8608AlogP: 4.11#Rotatable Bonds: 6
Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.11CX Basic pKa: CX LogP: 5.24CX LogD: 5.24
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.34

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source