The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4852974
PubChem CID: 164614525
Max Phase: Preclinical
Molecular Formula: C32H41NO5
Molecular Weight: 519.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OCCCCC(=O)N3CCCC3)ccc21
Standard InChI: InChI=1S/C32H41NO5/c1-31(2)20-26(24-13-11-22(35-5)18-28(24)37-31)27-21-32(3,4)38-29-19-23(12-14-25(27)29)36-17-9-6-10-30(34)33-15-7-8-16-33/h11-14,18-19H,6-10,15-17,20-21H2,1-5H3/b27-26+
Standard InChI Key: XNYHMKRRJJIGHP-CYYJNZCTSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
3.4000 -2.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2000 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6160 -1.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4543 -5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6293 -5.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0418 -6.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7736 -4.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7725 -5.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4873 -6.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4854 -4.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2008 -4.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1997 -5.6582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9127 -6.0712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6325 -4.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9150 -4.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9148 -3.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9204 -1.9433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2004 -3.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6331 -2.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6309 -3.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3368 -3.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0454 -3.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0437 -2.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3372 -1.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0576 -6.0727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3435 -5.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7571 -1.9438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4726 -2.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1861 -1.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9016 -2.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6150 -1.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3305 -2.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0440 -1.9334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3325 -3.1727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7945 -2.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3450 -1.6559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9308 -0.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1242 -1.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 5 1 0
5 14 1 0
14 15 1 0
16 20 1 0
16 18 1 0
19 17 1 0
17 2 1 0
2 18 1 0
15 16 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
8 25 1 0
25 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.68Molecular Weight (Monoisotopic): 519.2985AlogP: 6.90#Rotatable Bonds: 7Polar Surface Area: 57.23Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.22CX LogD: 5.22Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.10
References 1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A.. (2021) Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog., 50 [PMID:34469711 ] [10.1016/j.bmcl.2021.128340 ]