The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((3-(2-Chloroacetamido)benzyl)amino)-7-((4-(dimethylamino)phenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4853489
PubChem CID: 164616835
Max Phase: Preclinical
Molecular Formula: C24H25ClN8O2
Molecular Weight: 492.97
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(Nc2nc(NCc3cccc(NC(=O)CCl)c3)n3ccnc3c2C(N)=O)cc1
Standard InChI: InChI=1S/C24H25ClN8O2/c1-32(2)18-8-6-16(7-9-18)30-22-20(21(26)35)23-27-10-11-33(23)24(31-22)28-14-15-4-3-5-17(12-15)29-19(34)13-25/h3-12,30H,13-14H2,1-2H3,(H2,26,35)(H,28,31)(H,29,34)
Standard InChI Key: AACCPTJPXREQGW-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
4.7752 -11.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7752 -12.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4873 -12.6296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1993 -12.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4873 -10.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1962 -11.3945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8099 -10.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4803 -10.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6628 -10.1771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9139 -12.6336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9143 -13.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6290 -13.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0595 -10.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0571 -10.1609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3462 -11.4005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0613 -12.6349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0625 -13.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3472 -13.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3481 -14.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0637 -15.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7800 -14.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7756 -13.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6270 -14.6934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3409 -15.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0562 -14.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0531 -13.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3388 -13.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3408 -15.9305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0553 -16.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0552 -17.1681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7698 -15.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4842 -16.3431 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0694 -15.9319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3542 -16.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7848 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
10 11 1 0
11 12 1 0
1 13 1 0
13 14 1 0
13 15 2 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
12 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 12 1 0
24 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
33 34 1 0
33 35 1 0
20 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.97Molecular Weight (Monoisotopic): 492.1789AlogP: 3.43#Rotatable Bonds: 9Polar Surface Area: 129.68Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.22CX Basic pKa: 6.10CX LogP: 3.51CX LogD: 3.49Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.59
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]