The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(5-chloro-2-((3,5-difluorophenyl)amino)pyrimidin-4-yl)-N-(3-(diethylcarbamoyl)-4-(piperidin-1-yl)phenyl)pyrrolidine-2-carboxamide ID: ALA4853874
PubChem CID: 164612299
Max Phase: Preclinical
Molecular Formula: C31H36ClF2N7O2
Molecular Weight: 612.12
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)c1cc(NC(=O)[C@@H]2CCCN2c2nc(Nc3cc(F)cc(F)c3)ncc2Cl)ccc1N1CCCCC1
Standard InChI: InChI=1S/C31H36ClF2N7O2/c1-3-39(4-2)30(43)24-18-22(10-11-26(24)40-12-6-5-7-13-40)36-29(42)27-9-8-14-41(27)28-25(32)19-35-31(38-28)37-23-16-20(33)15-21(34)17-23/h10-11,15-19,27H,3-9,12-14H2,1-2H3,(H,36,42)(H,35,37,38)/t27-/m0/s1
Standard InChI Key: SVDMTCQJEQCHAR-MHZLTWQESA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
6.8067 -12.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6098 -12.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4687 -11.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8050 -11.3095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3602 -9.9570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1627 -10.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7178 -11.5776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0320 -11.5817 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.5798 -10.3524 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1930 -10.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5862 -11.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4077 -9.6341 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.1655 -11.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8556 -11.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0286 -10.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4649 -12.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0173 -11.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4187 -10.1836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0245 -9.8893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4515 -9.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0071 -11.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7426 -11.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4491 -9.1172 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8766 -11.5806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2938 -11.5788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0062 -10.3483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8036 -10.4770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4533 -11.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4140 -11.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2458 -11.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6387 -10.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7438 -10.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2861 -9.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8553 -12.3690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6861 -13.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2914 -13.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0693 -13.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2385 -12.6614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6298 -12.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1363 -9.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7506 -9.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9170 -8.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3027 -8.9011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24 11 1 0
22 28 1 0
16 30 2 0
14 16 1 0
29 27 2 0
26 12 1 0
27 15 1 0
13 24 1 0
30 29 1 0
10 4 2 0
20 32 1 0
20 23 1 0
25 21 1 0
22 8 1 0
28 13 2 0
10 5 1 0
31 18 1 0
26 33 1 0
21 26 2 0
3 31 1 6
3 7 1 0
11 25 2 0
31 19 2 0
6 20 2 0
32 22 2 0
17 3 1 0
1 2 1 0
21 7 1 0
13 6 1 0
7 1 1 0
2 17 1 0
18 15 1 0
9 11 1 0
29 10 1 0
15 14 2 0
33 9 2 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
30 34 1 0
5 40 1 0
5 41 1 0
41 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 612.12Molecular Weight (Monoisotopic): 611.2587AlogP: 6.23#Rotatable Bonds: 9Polar Surface Area: 93.70Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.06CX Basic pKa: 4.40CX LogP: 6.26CX LogD: 6.26Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.30Np Likeness Score: -1.82
References 1. Li T, Li C, Yang J, Guo M, Cao Z, Wang X, Jiang N, Zhai X.. (2021) Discovery of novel 2-phenylamino-4-prolylpyrimidine derivatives as TRK/ALK dual inhibitors with promising antitumor effects., 47 [PMID:34534734 ] [10.1016/j.bmc.2021.116396 ]