The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(beta-D-2-deoxyribofuranosyl)-8-octyloxy-1,3-diaza-2-oxophenoxazine ID: ALA4853972
PubChem CID: 164616264
Max Phase: Preclinical
Molecular Formula: C23H31N3O6
Molecular Weight: 445.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCOc1ccc2c(c1)Nc1nc(=O)n([C@H]3C[C@H](O)[C@@H](CO)O3)cc1O2
Standard InChI: InChI=1S/C23H31N3O6/c1-2-3-4-5-6-7-10-30-15-8-9-18-16(11-15)24-22-19(31-18)13-26(23(29)25-22)21-12-17(28)20(14-27)32-21/h8-9,11,13,17,20-21,27-28H,2-7,10,12,14H2,1H3,(H,24,25,29)/t17-,20+,21+/m0/s1
Standard InChI Key: RPHUSHHPICAQFF-IOMROCGXSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
1.5504 -2.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5493 -3.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9642 -2.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2555 -2.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9670 -3.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2561 -3.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2561 -4.6213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6779 -3.8003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6763 -4.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9648 -5.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9671 -5.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6793 -6.2659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3908 -5.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3902 -5.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6805 -7.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0196 -7.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2733 -8.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0905 -8.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3418 -7.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7939 -9.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1273 -9.7504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0993 -6.2597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2531 -1.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9596 -0.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6685 -1.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3750 -0.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0839 -1.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7904 -0.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4993 -1.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2058 -0.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9147 -1.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5718 -9.0017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
5 3 1 0
3 4 2 0
4 1 1 0
5 6 2 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 1 0
9 14 2 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
15 12 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
17 20 1 1
20 21 1 0
13 22 2 0
4 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
18 32 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.52Molecular Weight (Monoisotopic): 445.2213AlogP: 3.47#Rotatable Bonds: 10Polar Surface Area: 115.07Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.89CX Basic pKa: ┄CX LogP: 2.82CX LogD: 2.82Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: 0.44
References 1. Kozlovskaya LI, Volok VP, Shtro AA, Nikolaeva YV, Chistov AA, Matyugina ES, Belyaev ES, Jegorov AV, Snoeck R, Korshun VA, Andrei G, Osolodkin DI, Ishmukhametov AA, Aralov AV.. (2021) Phenoxazine nucleoside derivatives with a multiple activity against RNA and DNA viruses., 220 [PMID:33894564 ] [10.1016/j.ejmech.2021.113467 ]