The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(dimethylamino)-2-oxoethyl 4-(4-(1-acetylpiperidin-4-yl)phenyl)-7-(4-(trifluoromethyl)phenyl)-2-naphthoate ID: ALA4854018
PubChem CID: 164585412
Max Phase: Preclinical
Molecular Formula: C35H33F3N2O4
Molecular Weight: 602.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCC(c2ccc(-c3cc(C(=O)OCC(=O)N(C)C)cc4cc(-c5ccc(C(F)(F)F)cc5)ccc34)cc2)CC1
Standard InChI: InChI=1S/C35H33F3N2O4/c1-22(41)40-16-14-25(15-17-40)23-4-6-26(7-5-23)32-20-29(34(43)44-21-33(42)39(2)3)19-28-18-27(10-13-31(28)32)24-8-11-30(12-9-24)35(36,37)38/h4-13,18-20,25H,14-17,21H2,1-3H3
Standard InChI Key: URVGMSBCAUNNDU-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
29.2470 -7.3438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5422 -6.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0281 -5.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4422 -7.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9262 -6.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2194 -6.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7042 -5.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8957 -5.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6050 -6.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1221 -6.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3495 -6.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8629 -7.0882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6434 -5.6900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1532 -8.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3451 -8.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0540 -9.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5700 -9.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3806 -9.6280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6679 -8.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3824 -4.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6744 -4.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1587 -3.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3511 -3.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0617 -4.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5792 -5.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8339 -3.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1232 -2.2743 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.0274 -3.1702 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.2516 -2.4557 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2802 -10.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4507 -5.5632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7446 -4.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5519 -4.6739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8458 -3.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0653 -5.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2312 -4.1649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4762 -10.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1858 -11.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6965 -12.0358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5012 -11.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7953 -11.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4025 -12.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5952 -12.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9159 -13.4341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
11 12 2 0
11 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
4 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
8 20 1 0
23 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
17 30 1 0
13 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
32 36 2 0
30 37 1 0
30 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 0
42 43 1 0
42 44 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.65Molecular Weight (Monoisotopic): 602.2392AlogP: 7.16#Rotatable Bonds: 6Polar Surface Area: 66.92Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.97CX LogD: 5.97Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.22Np Likeness Score: -0.83
References 1. Jung YH, Salmaso V, Wen Z, Bennett JM, Phung NB, Lieberman DI, Gopinatth V, Randle JCR, Chen Z, Salvemini D, Karcz TP, Cook DN, Jacobson KA.. (2021) Structure-Activity Relationship of Heterocyclic P2Y14 Receptor Antagonists: Removal of the Zwitterionic Character with Piperidine Bioisosteres., 64 (8.0): [PMID:33787273 ] [10.1021/acs.jmedchem.1c00164 ]