The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Miaosporones B ID: ALA4854315
PubChem CID: 164612918
Max Phase: Preclinical
Molecular Formula: C19H22O7
Molecular Weight: 362.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C[C@@H](O)[C@H]2[C@](O)(CC[C@]3(O)C(=O)c4c(O)cccc4[C@H](O)[C@@]23O)C1
Standard InChI: InChI=1S/C19H22O7/c1-9-7-12(21)14-17(24,8-9)5-6-18(25)16(23)13-10(3-2-4-11(13)20)15(22)19(14,18)26/h2-4,7,12,14-15,20-22,24-26H,5-6,8H2,1H3/t12-,14+,15+,17+,18+,19+/m1/s1
Standard InChI Key: MFRIJNSUVKFENJ-DCYJUTBRSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
9.7146 -3.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7135 -3.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4279 -4.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4261 -2.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1411 -3.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1419 -3.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8568 -4.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8513 -2.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5668 -2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5703 -3.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2892 -4.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0048 -3.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2778 -2.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9957 -2.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7059 -2.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6993 -1.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9766 -1.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2695 -1.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5507 -1.3530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4093 -1.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7052 -3.3983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2726 -3.4024 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.8590 -5.0650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8468 -1.7646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4298 -5.0710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5604 -2.1698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5646 -4.6477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 1 0
9 8 1 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 14 1 0
13 9 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 13 1 0
18 19 1 6
16 20 1 0
14 21 1 6
13 22 1 6
7 23 2 0
8 24 1 6
3 25 1 0
9 26 1 6
10 27 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.38Molecular Weight (Monoisotopic): 362.1366AlogP: -0.06#Rotatable Bonds: ┄Polar Surface Area: 138.45Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.45CX Basic pKa: ┄CX LogP: -0.23CX LogD: -0.26Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.36Np Likeness Score: 2.35
References 1. Saepua S, Kornsakulkarn J, Choowong W, Suriyachadkun C, Boonlarppradab C, Thongpanchang C.. (2021) Antimicrobial and Cytotoxic Angucyclic Quinones from Actinomadura miaoliensis ., 84 (11.0): [PMID:34748348 ] [10.1021/acs.jnatprod.1c00232 ]