9-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1-(3-fluorophenyl)-1H-purin-6(9H)-one

ID: ALA4854609

PubChem CID: 140551206

Max Phase: Preclinical

Molecular Formula: C16H15FN4O5

Molecular Weight: 362.32

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2ncn1-c1cccc(F)c1

Standard InChI:  InChI=1S/C16H15FN4O5/c17-8-2-1-3-9(4-8)20-7-19-14-11(15(20)25)18-6-21(14)16-13(24)12(23)10(5-22)26-16/h1-4,6-7,10,12-13,16,22-24H,5H2/t10-,12-,13-,16-/m1/s1

Standard InChI Key:  JZNPCDSFDKNEGD-XNIJJKJLSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    9.6413  -11.3252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3534  -10.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3534  -10.0918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6413   -9.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9294  -10.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9247  -10.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1388   -9.8412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6575  -10.5114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1461  -11.1761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6424   -8.8501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0654   -9.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7790  -10.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4942   -9.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4970   -8.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7787   -8.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0664   -8.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2072  -10.1050    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.9007  -11.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1175  -12.2237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1220  -13.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9081  -13.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3893  -12.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4573  -13.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7018  -13.2059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1674  -14.0825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2143  -12.6246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  4 10  2  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 11  1  0
 13 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 18  9  1  1
 20 23  1  1
 23 24  1  0
 21 25  1  6
 22 26  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4854609

    ---

Associated Targets(non-human)

Orthohantavirus hantanense (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.32Molecular Weight (Monoisotopic): 362.1026AlogP: -0.67#Rotatable Bonds: 3
Polar Surface Area: 122.63Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.45CX Basic pKa: 1.52CX LogP: -0.45CX LogD: -0.45
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: 0.04

References

1. Yarovaya OI, Kovaleva KS, Zaykovskaya AA, Yashina LN, Scherbakova NS, Scherbakov DN, Borisevich SS, Zubkov FI, Antonova AS, Peshkov RY, Eltsov IV, Pyankov OV, Maksyutov RA, Salakhutdinov NF..  (2021)  New class of hantaan virus inhibitors based on conjugation of the isoindole fragment to (+)-camphor or (-)-fenchone hydrazonesv.,  40  [PMID:33705902] [10.1016/j.bmcl.2021.127926]

Source