1-methyl-5-(4-(2-(methylamino)ethyl)phenyl)-6-((1-phenylethyl)thio)-1H-pyrazolo[3,4-d]pyrimidin-4(5H)-one

ID: ALA4854678

PubChem CID: 164611285

Max Phase: Preclinical

Molecular Formula: C23H25N5OS

Molecular Weight: 419.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCc1ccc(-n2c(SC(C)c3ccccc3)nc3c(cnn3C)c2=O)cc1

Standard InChI:  InChI=1S/C23H25N5OS/c1-16(18-7-5-4-6-8-18)30-23-26-21-20(15-25-27(21)3)22(29)28(23)19-11-9-17(10-12-19)13-14-24-2/h4-12,15-16,24H,13-14H2,1-3H3

Standard InChI Key:  WYEFYTRRGYXTGL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   25.0302  -14.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0291  -15.6321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7371  -16.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4468  -15.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4440  -14.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7353  -14.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3176  -16.0425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6069  -15.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6114  -17.2714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3194  -16.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6083  -14.8100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8952  -16.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8960  -16.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1123  -15.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6271  -16.4473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1110  -17.1145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8578  -17.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0272  -17.2674    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.0277  -18.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7356  -18.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7310  -19.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4381  -19.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1466  -19.3073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1434  -18.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4358  -18.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3202  -18.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1501  -14.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8594  -14.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5655  -14.3924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2748  -14.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  8 13  1  0
 12  9  1  0
  9 10  2  0
 10  7  1  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 16 17  1  0
 10 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
  5 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4854678

    ---

Associated Targets(Human)

ALDH1A2 Tchem Retinal dehydrogenase 2 (226 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALDH1A3 Tchem Aldehyde dehydrogenase 1A3 (336 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALDH1A1 Tchem Aldehyde dehydrogenase 1A1 (77053 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.55Molecular Weight (Monoisotopic): 419.1780AlogP: 3.73#Rotatable Bonds: 7
Polar Surface Area: 64.74Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.07CX LogP: 4.33CX LogD: 1.76
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -1.63

References

1. Huddle BC, Grimley E, Chtcherbinine M, Buchman CD, Takahashi C, Debnath B, McGonigal SC, Mao S, Li S, Felton J, Pan S, Wen B, Sun D, Neamati N, Buckanovich RJ, Hurley TD, Larsen SD..  (2021)  Development of 2,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one inhibitors of aldehyde dehydrogenase 1A (ALDH1A) as potential adjuncts to ovarian cancer chemotherapy.,  211  [PMID:33341649] [10.1016/j.ejmech.2020.113060]

Source