3-((2-chloro-4-(trifluoromethyl)phenoxy)methyl)-2-fluorobenzoic acid

ID: ALA4855031

PubChem CID: 155145968

Max Phase: Preclinical

Molecular Formula: C15H9ClF4O3

Molecular Weight: 348.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1F

Standard InChI:  InChI=1S/C15H9ClF4O3/c16-11-6-9(15(18,19)20)4-5-12(11)23-7-8-2-1-3-10(13(8)17)14(21)22/h1-6H,7H2,(H,21,22)

Standard InChI Key:  TWOXPNAILYKJPT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   28.0720  -22.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0708  -23.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7789  -24.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4886  -23.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4857  -22.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7771  -22.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3642  -22.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3640  -21.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6566  -22.9848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1919  -22.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9011  -22.9756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6073  -22.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3150  -22.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0206  -22.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0180  -21.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3038  -21.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6010  -21.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7236  -21.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4334  -21.7378    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.7195  -20.5156    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.4293  -20.9168    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.7747  -21.7584    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.8902  -21.3490    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
  6 22  1  0
 17 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4855031

    ---

Associated Targets(Human)

MRGPRX4 Tchem Mas-related G-protein coupled receptor member X4 (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.68Molecular Weight (Monoisotopic): 348.0176AlogP: 4.78#Rotatable Bonds: 4
Polar Surface Area: 46.53Molecular Species: ACIDHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.25CX Basic pKa: CX LogP: 4.82CX LogD: 1.39
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.81Np Likeness Score: -1.25

References

1.  (2020)  Modulators of mas-related g-protein receptor x4 and related products and methods, 

Source