5-((3-Acrylamidobenzyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide

ID: ALA4855263

PubChem CID: 164615169

Max Phase: Preclinical

Molecular Formula: C25H25N7O4

Molecular Weight: 487.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cccc(CNc2nc(Nc3cc(OC)cc(OC)c3)c(C(N)=O)c3nccn23)c1

Standard InChI:  InChI=1S/C25H25N7O4/c1-4-20(33)29-16-7-5-6-15(10-16)14-28-25-31-23(21(22(26)34)24-27-8-9-32(24)25)30-17-11-18(35-2)13-19(12-17)36-3/h4-13,30H,1,14H2,2-3H3,(H2,26,34)(H,28,31)(H,29,33)

Standard InChI Key:  NRYMUWOQWWUMKP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   34.3639   -6.7170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0848   -7.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7928   -6.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0975   -7.9434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5135   -7.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3513   -5.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7834   -2.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7834   -3.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4953   -3.4166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2073   -3.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4953   -1.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2043   -2.1815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8180   -1.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4883   -0.8832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6710   -0.9642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9220   -3.4206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9223   -4.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6370   -4.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0677   -1.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0653   -0.9480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3544   -2.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0695   -3.4219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0706   -4.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3554   -4.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3563   -5.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0719   -5.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7881   -5.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7838   -4.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5047   -5.8857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5087   -6.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6422   -5.8956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6430   -6.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6351   -5.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0642   -5.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0611   -4.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3468   -4.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  2  0
  1  6  1  0
  7  8  2  0
  7 11  1  0
  8  9  1  0
  9 10  2  0
 10 12  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  2  0
 10 16  1  0
 16 17  1  0
 17 18  1  0
  7 19  1  0
 19 20  1  0
 19 21  2  0
  8 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 27 29  1  0
 29 30  1  0
 25 31  1  0
 31 32  1  0
 18 33  2  0
 33  6  1  0
  6 34  2  0
 34 35  1  0
 35 36  2  0
 36 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4855263

    ---

Associated Targets(Human)

ZAP70 Tchem Tyrosine-protein kinase ZAP-70 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SYK Tclin Tyrosine-protein kinase SYK (7372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.52Molecular Weight (Monoisotopic): 487.1968AlogP: 3.33#Rotatable Bonds: 10
Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.70CX Basic pKa: 5.10CX LogP: 3.31CX LogD: 3.31
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.11

References

1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S..  (2021)  Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor.,  219  [PMID:33845236] [10.1016/j.ejmech.2021.113393]

Source