The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(4-(5-chloro-4-(2-(isopropylsulfonyl)phenylamino)pyrimidin-2-ylamino)phenyl)-N8-hydroxyoctanediamide ID: ALA4855319
PubChem CID: 164616925
Max Phase: Preclinical
Molecular Formula: C27H33ClN6O5S
Molecular Weight: 589.12
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(NC(=O)CCCCCCC(=O)NO)cc2)ncc1Cl
Standard InChI: InChI=1S/C27H33ClN6O5S/c1-18(2)40(38,39)23-10-8-7-9-22(23)32-26-21(28)17-29-27(33-26)31-20-15-13-19(14-16-20)30-24(35)11-5-3-4-6-12-25(36)34-37/h7-10,13-18,37H,3-6,11-12H2,1-2H3,(H,30,35)(H,34,36)(H2,29,31,32,33)
Standard InChI Key: LQLASCOWIMXGMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
30.3541 -1.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3458 -0.5570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0660 -1.7755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0493 -0.1412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6476 -1.7848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4157 -3.6320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6274 -3.8466 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.2074 -4.4220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7432 -1.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7421 -2.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4501 -3.0321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1598 -2.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1570 -1.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4484 -1.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8682 -3.0301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5752 -2.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2802 -3.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9868 -2.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9860 -1.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2727 -1.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5690 -1.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0341 -3.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3267 -2.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3319 -1.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6253 -1.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9163 -1.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9183 -2.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6254 -3.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9221 -4.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9251 -5.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2129 -3.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0354 -1.3951 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.6925 -1.3906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4014 -1.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1079 -1.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4038 -2.6143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8168 -1.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5233 -1.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2322 -1.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9387 -1.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
2 4 1 0
5 1 1 0
7 6 2 0
8 7 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
10 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 7 1 0
7 29 1 0
29 30 1 0
29 31 1 0
9 32 1 0
19 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 589.12Molecular Weight (Monoisotopic): 588.1922AlogP: 5.58#Rotatable Bonds: 14Polar Surface Area: 162.41Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.91CX Basic pKa: 3.68CX LogP: 4.76CX LogD: 4.74Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.09Np Likeness Score: -1.25
References 1. Pan T, Dan Y, Guo D, Jiang J, Ran D, Zhang L, Tian B, Yuan J, Yu Y, Gan Z.. (2021) Discovery of 2,4-pyrimidinediamine derivatives as potent dual inhibitors of ALK and HDAC., 224 [PMID:34237620 ] [10.1016/j.ejmech.2021.113672 ]