The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(6-(((3aR,5s,6aS)-2-((tetrahydro-2H-pyran-4-yl)methyl)octahydrocyclopenta[c]pyrrol-5-yl)amino)pyridazin-3-yl)phenyl)acetamide ID: ALA4855467
PubChem CID: 156493644
Max Phase: Preclinical
Molecular Formula: C25H33N5O2
Molecular Weight: 435.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(-c2ccc(N[C@H]3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)cc1
Standard InChI: InChI=1S/C25H33N5O2/c1-17(31)26-22-4-2-19(3-5-22)24-6-7-25(29-28-24)27-23-12-20-15-30(16-21(20)13-23)14-18-8-10-32-11-9-18/h2-7,18,20-21,23H,8-16H2,1H3,(H,26,31)(H,27,29)/t20-,21+,23+
Standard InChI Key: TZSADVGJILSNGR-SGRGSNTQSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.6046 -9.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6034 -10.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3115 -10.9151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0211 -10.5056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0183 -9.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3097 -9.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7245 -9.2717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4337 -9.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8973 -10.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1896 -10.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4821 -10.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4810 -11.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1933 -12.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8980 -11.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5258 -10.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1826 -9.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7318 -9.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3298 -10.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8807 -11.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6234 -10.9202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5312 -10.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3345 -11.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0387 -10.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7483 -11.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4505 -10.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4478 -10.0869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7369 -9.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0285 -10.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9160 -11.3623 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.1336 -9.2326 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.7735 -12.1379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0656 -11.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3581 -12.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0651 -10.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
8 7 1 6
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
2 9 1 0
8 15 1 0
15 18 1 0
17 16 1 0
16 8 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
20 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
18 29 1 6
17 30 1 6
12 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.57Molecular Weight (Monoisotopic): 435.2634AlogP: 3.65#Rotatable Bonds: 6Polar Surface Area: 79.38Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.84CX LogP: 1.97CX LogD: -1.19Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.72Np Likeness Score: -1.29
References 1. Spock M, Carter TR, Bollinger KA, Han C, Baker LA, Rodriguez AL, Peng L, Dickerson JW, Qi A, Rook JM, O'Neill JC, Watson KJ, Chang S, Bridges TM, Engers JL, Engers DW, Niswender CM, Conn PJ, Lindsley CW, Bender AM.. (2021) Discovery of VU6028418: A Highly Selective and Orally Bioavailable M4 Muscarinic Acetylcholine Receptor Antagonist., 12 (8.0): [PMID:34413964 ] [10.1021/acsmedchemlett.1c00363 ]