(S)-1-((4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)-1-phenylethanol

ID: ALA4855992

PubChem CID: 164610805

Max Phase: Preclinical

Molecular Formula: C26H27FN2O

Molecular Weight: 402.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC[C@@H]2[C@](C)(O)c1ccccc1

Standard InChI:  InChI=1S/C26H27FN2O/c1-25-16-18-17-28-29(22-13-11-21(27)12-14-22)23(18)15-20(25)9-6-10-24(25)26(2,30)19-7-4-3-5-8-19/h3-5,7-8,11-15,17,24,30H,6,9-10,16H2,1-2H3/t24-,25-,26+/m0/s1

Standard InChI Key:  IAYCWCZQCSBSEJ-KKUQBAQOSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   14.6157  -10.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4376  -10.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0302   -9.9583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4412  -13.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1547  -12.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1547  -11.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4412  -11.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7278  -12.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7304  -11.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0184  -11.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0173  -13.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3048  -12.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3036  -11.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5199  -11.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0393  -12.3328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5218  -12.9990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2728  -13.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4636  -13.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2107  -14.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7618  -15.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5732  -15.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8266  -14.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1550  -10.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2346  -11.2824    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5083  -16.1375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.8681  -10.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5850  -10.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5872   -9.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8665   -9.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1525   -9.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7304  -11.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
  9  7  1  0
  8  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  1  0
  9 10  1  0
 10 13  1  0
 12 11  1  0
 11  8  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 17  1  0
  7  2  1  0
  2 23  1  0
  7 24  1  6
 20 25  1  0
 23 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 23  1  0
  9 31  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4855992

    ---

Associated Targets(non-human)

Nr3c1 Glucocorticoid receptor (1330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.51Molecular Weight (Monoisotopic): 402.2107AlogP: 5.67#Rotatable Bonds: 3
Polar Surface Area: 38.05Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.60CX LogP: 5.54CX LogD: 5.54
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -0.13

References

1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR..  (2021)  Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion.,  12  (10.0): [PMID:34676039] [10.1021/acsmedchemlett.1c00379]

Source