The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((6,7-dimethoxy-2-(5-methylfuran-2-yl)quinolin-4-ylamino)methyl)piperidin-1-yl)-N-hydroxypyrimidine-5-carboxamide ID: ALA4856110
PubChem CID: 146284820
Max Phase: Preclinical
Molecular Formula: C27H30N6O5
Molecular Weight: 518.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nc(-c3ccc(C)o3)cc(NCC3CCN(c4ncc(C(=O)NO)cn4)CC3)c2cc1OC
Standard InChI: InChI=1S/C27H30N6O5/c1-16-4-5-23(38-16)22-11-20(19-10-24(36-2)25(37-3)12-21(19)31-22)28-13-17-6-8-33(9-7-17)27-29-14-18(15-30-27)26(34)32-35/h4-5,10-12,14-15,17,35H,6-9,13H2,1-3H3,(H,28,31)(H,32,34)
Standard InChI Key: DDJFEVNAMKGVES-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
1.6495 -17.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6483 -18.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3564 -18.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3546 -17.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0632 -17.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0640 -18.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7725 -18.9200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4808 -18.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4760 -17.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7669 -17.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1897 -18.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9362 -17.2872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2286 -17.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9403 -18.9251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9397 -19.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7626 -16.4665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4681 -16.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1772 -16.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1731 -17.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8781 -17.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5899 -17.2919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5922 -16.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8827 -16.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2959 -17.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2908 -18.5199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9960 -18.9314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7063 -18.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7071 -17.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0014 -17.2965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4129 -18.9363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4106 -19.7535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1217 -18.5297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8283 -18.9403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2816 -19.7212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0805 -19.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4840 -19.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9344 -18.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4175 -20.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
12 13 1 0
1 12 1 0
2 14 1 0
14 15 1 0
10 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 21 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 24 2 0
27 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
11 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 11 2 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.57Molecular Weight (Monoisotopic): 518.2278AlogP: 4.06#Rotatable Bonds: 8Polar Surface Area: 134.87Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.72CX Basic pKa: 6.25CX LogP: 2.56CX LogD: 2.51Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: -1.12
References 1. Rabal O, San José-Enériz E, Agirre X, Sánchez-Arias JA, de Miguel I, Ordoñez R, Garate L, Miranda E, Sáez E, Vilas-Zornoza A, Pineda-Lucena A, Estella A, Zhang F, Wu W, Xu M, Prosper F, Oyarzabal J.. (2021) Design and Synthesis of Novel Epigenetic Inhibitors Targeting Histone Deacetylases, DNA Methyltransferase 1, and Lysine Methyltransferase G9a with In Vivo Efficacy in Multiple Myeloma., 64 (6.0): [PMID:33661013 ] [10.1021/acs.jmedchem.0c02255 ]