(R)-(4-fluorophenyl)((4aR,5S)-1-(4-methoxyphenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)methanol

ID: ALA4856145

PubChem CID: 164609739

Max Phase: Preclinical

Molecular Formula: C26H27FN2O2

Molecular Weight: 418.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@H](O)c4ccc(F)cc4)[C@@]2(C)C3)cc1

Standard InChI:  InChI=1S/C26H27FN2O2/c1-26-15-18-16-28-29(21-10-12-22(31-2)13-11-21)24(18)14-19(26)4-3-5-23(26)25(30)17-6-8-20(27)9-7-17/h6-14,16,23,25,30H,3-5,15H2,1-2H3/t23-,25+,26+/m1/s1

Standard InChI Key:  WGXZEYPOFOTRPN-AFESJLNVSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    6.2116  -15.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9253  -15.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9253  -14.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2116  -13.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4978  -15.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5003  -14.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7881  -13.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7871  -15.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0743  -15.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0731  -14.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2891  -14.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8083  -14.6997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2912  -15.3661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0419  -16.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2325  -16.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9795  -17.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5308  -17.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3426  -17.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5959  -16.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2101  -13.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9255  -12.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4932  -12.6287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0051  -13.6490    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2772  -18.5057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6377  -13.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3526  -12.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3537  -11.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6339  -11.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9219  -11.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0656  -11.3908    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8277  -19.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5003  -13.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  8  5  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 14  1  0
  4 20  1  0
 20 21  1  0
 20 22  1  1
  4 23  1  6
 17 24  1  0
 21 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 21  1  0
 27 30  1  0
 24 31  1  0
  6 32  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4856145

    ---

Associated Targets(non-human)

Nr3c1 Glucocorticoid receptor (1330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.51Molecular Weight (Monoisotopic): 418.2057AlogP: 5.50#Rotatable Bonds: 4
Polar Surface Area: 47.28Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.60CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.15

References

1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR..  (2021)  Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion.,  12  (10.0): [PMID:34676039] [10.1021/acsmedchemlett.1c00379]

Source