The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{3-[6-(1-Hydroxy-1-methyl-ethyl)-1-oxy-pyridin-3-yl]-phenyl}-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid cyclopropylamide ID: ALA485620
PubChem CID: 10297996
Max Phase: Preclinical
Molecular Formula: C26H24N4O4
Molecular Weight: 456.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)c1ccc(-c2cccc(-n3cc(C(=O)NC4CC4)c(=O)c4cccnc43)c2)c[n+]1[O-]
Standard InChI: InChI=1S/C26H24N4O4/c1-26(2,33)22-11-8-17(14-30(22)34)16-5-3-6-19(13-16)29-15-21(25(32)28-18-9-10-18)23(31)20-7-4-12-27-24(20)29/h3-8,11-15,18,33H,9-10H2,1-2H3,(H,28,32)
Standard InChI Key: GVABMKVKGRIEOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.0630 -2.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0630 -3.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3485 -3.4654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3485 -1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3660 -2.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3660 -3.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0804 -3.4654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7949 -3.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7949 -2.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0804 -1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0804 -0.9904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0804 -4.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3660 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3660 -5.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0804 -5.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7949 -5.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7949 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5094 -1.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 -2.2279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5094 -5.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 -5.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9383 -5.9404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9383 -6.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 -7.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5094 -6.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5094 -0.9904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 -0.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0488 -0.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6363 0.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6528 -7.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3673 -7.5904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2403 -7.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0653 -6.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6528 -5.5279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16 17 2 0
17 12 1 0
7 12 1 0
5 4 2 0
9 18 1 0
8 9 2 0
18 19 2 0
4 1 1 0
9 10 1 0
20 21 2 0
10 5 1 0
21 22 1 0
22 23 2 0
10 11 2 0
23 24 1 0
2 3 1 0
24 25 2 0
25 20 1 0
16 20 1 0
5 6 1 0
18 26 1 0
12 13 2 0
26 27 1 0
28 27 1 0
29 28 1 0
27 29 1 0
3 6 2 0
13 14 1 0
6 7 1 0
23 30 1 0
14 15 2 0
30 31 1 0
1 2 2 0
30 32 1 0
15 16 1 0
30 33 1 0
7 8 1 0
22 34 1 0
M CHG 2 22 1 34 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.50Molecular Weight (Monoisotopic): 456.1798AlogP: 2.81#Rotatable Bonds: 5Polar Surface Area: 111.16Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.87CX Basic pKa: 1.86CX LogP: 1.87CX LogD: 1.87Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.94
References 1. Guay D, Boulet L, Friesen RW, Girard M, Hamel P, Huang Z, Laliberté F, Laliberté S, Mancini JA, Muise E, Pon D, Styhler A.. (2008) Optimization and structure-activity relationship of a series of 1-phenyl-1,8-naphthyridin-4-one-3-carboxamides: identification of MK-0873, a potent and effective PDE4 inhibitor., 18 (20): [PMID:18835163 ] [10.1016/j.bmcl.2008.09.009 ]