tert-Butyl 4-((6-(5-(methylsulfonyl)-2,3-dihydro-1H-indol-1-yl)pyrimidin-4-yl)amino)piperidine-1-carboxylate

ID: ALA4856239

PubChem CID: 58074125

Max Phase: Preclinical

Molecular Formula: C23H31N5O4S

Molecular Weight: 473.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)N1CCC(Nc2cc(N3CCc4cc(S(C)(=O)=O)ccc43)ncn2)CC1

Standard InChI:  InChI=1S/C23H31N5O4S/c1-23(2,3)32-22(29)27-10-8-17(9-11-27)26-20-14-21(25-15-24-20)28-12-7-16-13-18(33(4,30)31)5-6-19(16)28/h5-6,13-15,17H,7-12H2,1-4H3,(H,24,25,26)

Standard InChI Key:  QVKLNBIURDBXIF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   11.3039   -3.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3081   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0204   -3.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8375   -1.0916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2541   -1.8083    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6664   -1.0891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9694   -2.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9682   -3.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3966   -2.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6812   -1.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3994   -3.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6819   -3.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8520   -4.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6748   -4.3577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0130   -3.6027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8203   -3.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3673   -4.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1739   -3.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4313   -3.0929    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8759   -2.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0713   -2.6495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7243   -4.4922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5317   -4.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0804   -4.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8847   -4.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1460   -3.9936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5965   -3.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7857   -3.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9540   -3.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5020   -4.4441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2140   -3.0444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5404   -2.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8581   -4.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8 12  1  0
 11  9  1  0
  9 10  2  0
 10  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 18 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
 29 31  2  0
  7  5  1  0
  5 32  1  0
 30  2  1  0
  2 33  1  0
M  END

Associated Targets(Human)

GPR119 Tclin Glucose-dependent insulinotropic receptor (4762 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.60Molecular Weight (Monoisotopic): 473.2097AlogP: 3.39#Rotatable Bonds: 4
Polar Surface Area: 104.73Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.97CX LogP: 2.18CX LogD: 2.17
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.72Np Likeness Score: -1.71

References

1. Kubo O, Takami K, Kamaura M, Watanabe K, Miyashita H, Abe S, Matsuda K, Tsujihata Y, Odani T, Iwasaki S, Kitazaki T, Murata T, Sato K..  (2021)  Discovery of a novel series of GPR119 agonists: Design, synthesis, and biological evaluation of N-(Piperidin-4-yl)-N-(trifluoromethyl)pyrimidin-4-amine derivatives.,  41  [PMID:34010766] [10.1016/j.bmc.2021.116208]

Source