N4-(5-ethyl-1H-pyrazol-3-yl)-6-fluoro-N2-(4-fluorophenethyl)quinazoline-2,4-diamine

ID: ALA4856240

PubChem CID: 164611872

Max Phase: Preclinical

Molecular Formula: C21H20F2N6

Molecular Weight: 394.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc(Nc2nc(NCCc3ccc(F)cc3)nc3ccc(F)cc23)n[nH]1

Standard InChI:  InChI=1S/C21H20F2N6/c1-2-16-12-19(29-28-16)26-20-17-11-15(23)7-8-18(17)25-21(27-20)24-10-9-13-3-5-14(22)6-4-13/h3-8,11-12H,2,9-10H2,1H3,(H3,24,25,26,27,28,29)

Standard InChI Key:  CAVQKELZJYSUST-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   41.0732   -5.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0819   -4.7567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3709   -4.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3575   -5.9903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6459   -5.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6527   -4.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9413   -4.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2225   -4.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2196   -5.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9317   -5.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3766   -3.5123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0939   -3.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8419   -3.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3982   -2.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9905   -2.1217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1824   -2.2878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2180   -2.9309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7075   -2.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7839   -6.0030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5020   -5.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2128   -6.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9310   -5.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6395   -6.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3572   -5.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3651   -4.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6493   -4.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9345   -4.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0827   -4.3936    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.5101   -4.3221    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 12  2  0
 14 17  1  0
 17 18  1  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
  8 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856240

    ---

Associated Targets(Human)

GRK6 Tchem G protein-coupled receptor kinase 6 (1545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 394.43Molecular Weight (Monoisotopic): 394.1718AlogP: 4.59#Rotatable Bonds: 7
Polar Surface Area: 78.52Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.92CX Basic pKa: 4.61CX LogP: 5.53CX LogD: 5.53
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.43Np Likeness Score: -1.40

References

1. Uehling DE, Joseph B, Chung KC, Zhang AX, Ler S, Prakesch MA, Poda G, Grouleff J, Aman A, Kiyota T, Leung-Hagesteijn C, Konda JD, Marcellus R, Griffin C, Subramaniam R, Abibi A, Strathdee CA, Isaac MB, Al-Awar R, Tiedemann RE..  (2021)  Design, Synthesis, and Characterization of 4-Aminoquinazolines as Potent Inhibitors of the G Protein-Coupled Receptor Kinase 6 (GRK6) for the Treatment of Multiple Myeloma.,  64  (15.0): [PMID:34291633] [10.1021/acs.jmedchem.1c00506]
2. Tesmer, John J G JJ, Tesmer, Valerie M VM, Lodowski, David T DT, Steinhagen, Henning H and Huber, Jochen J.  2010-02-25  Structure of human G protein-coupled receptor kinase 2 in complex with the kinase inhibitor balanol.  [PMID:20128603]

Source