methyl (R)-5-((4-(3-aminopiperidin-1-yl)-3-(but-2-yn-1-yl)-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl)methyl)-2-bromobenzoate

ID: ALA4856255

PubChem CID: 164611883

Max Phase: Preclinical

Molecular Formula: C22H25BrN4O4

Molecular Weight: 489.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC#CCn1c(N2CCC[C@@H](N)C2)cc(=O)n(Cc2cc(C(=O)OC)ccc2Br)c1=O

Standard InChI:  InChI=1S/C22H25BrN4O4/c1-3-4-10-26-19(25-9-5-6-17(24)14-25)12-20(28)27(22(26)30)13-16-11-15(21(29)31-2)7-8-18(16)23/h7-8,11-12,17H,5-6,9-10,13-14,24H2,1-2H3/t17-/m1/s1

Standard InChI Key:  YLRRGRLUNMSFLF-QGZVFWFLSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    4.1753  -20.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1742  -21.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8822  -21.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5919  -21.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5891  -20.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8804  -20.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7368  -19.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4461  -20.3837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4466  -21.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1518  -21.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8603  -21.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8592  -20.3825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1495  -19.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5680  -21.6093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5648  -22.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2685  -22.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9786  -22.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9806  -21.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2724  -21.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1474  -19.1550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7393  -21.6119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5668  -19.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5665  -19.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5662  -18.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5659  -17.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6897  -21.2075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3002  -21.8627    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    3.4648  -20.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4646  -19.4119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7572  -20.6379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1723  -19.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 13 20  2  0
  9 21  2  0
 12 22  1  0
 22 23  1  0
 23 24  3  0
 24 25  1  0
 18 26  1  6
  4 27  1  0
 28 29  1  0
 28 30  2  0
  1 28  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856255

    ---

Associated Targets(Human)

DPP9 Tchem Dipeptidyl peptidase IX (1624 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP8 Tchem Dipeptidyl peptidase VIII (2139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP4 Tclin Dipeptidyl peptidase IV (7109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.37Molecular Weight (Monoisotopic): 488.1059AlogP: 1.56#Rotatable Bonds: 5
Polar Surface Area: 99.56Molecular Species: BASEHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.47CX LogP: 3.14CX LogD: 1.11
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -0.75

References

1. Li Q, Deng X, Jiang N, Meng L, Xing J, Jiang W, Xu Y..  (2021)  Identification and structure-activity relationship exploration of uracil-based benzoic acid and ester derivatives as novel dipeptidyl Peptidase-4 inhibitors for the treatment of type 2 diabetes mellitus.,  225  [PMID:34399391] [10.1016/j.ejmech.2021.113765]

Source