Methyl-2-methyl-9-(quinolin-2-ylmethyl)-9H-benzo[d]imidazo[1,2-a]imidazole-3-carboxylate

ID: ALA4856407

PubChem CID: 164613014

Max Phase: Preclinical

Molecular Formula: C22H18N4O2

Molecular Weight: 370.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1c(C)nc2n(Cc3ccc4ccccc4n3)c3ccccc3n12

Standard InChI:  InChI=1S/C22H18N4O2/c1-14-20(21(27)28-2)26-19-10-6-5-9-18(19)25(22(26)23-14)13-16-12-11-15-7-3-4-8-17(15)24-16/h3-12H,13H2,1-2H3

Standard InChI Key:  VRCVKQPQMSBPBU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   10.5816   -7.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8035   -7.5120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2952   -6.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7577   -6.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5504   -6.4072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3726   -7.4563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8314   -6.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3267   -6.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3959   -5.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5717   -5.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1092   -6.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4709   -6.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5515   -5.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3515   -5.1333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0115   -4.7063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5750   -8.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2017   -7.9147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7768   -8.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5483   -9.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7483   -9.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1731   -8.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3732   -9.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8017   -8.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0303   -7.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8303   -7.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4017   -8.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6574   -6.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2008   -4.8670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  5  8  1  0
  1  6  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  3 12  2  0
  4  9  2  0
 13 14  2  0
 13 15  1  0
  8 13  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 17 26  1  0
 21 26  1  0
 16 18  1  0
  2 16  1  0
  7 27  1  0
 15 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856407

    ---

Associated Targets(Human)

TRPM2 Tchem Transient receptor potential cation channel subfamily M member 2 (348 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.41Molecular Weight (Monoisotopic): 370.1430AlogP: 3.98#Rotatable Bonds: 3
Polar Surface Area: 61.42Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.57CX LogP: 3.31CX LogD: 3.31
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.45Np Likeness Score: -1.15

References

1. Zhao S, Zhang H, Jin H, Cai X, Zhang R, Jin Z, Yang W, Yu P, Zhang L, Liu Z..  (2021)  Design, synthesis and biological activities of benzo[d]imidazo[1,2-a]imidazole derivatives as TRPM2-specfic inhibitors.,  225  [PMID:34416664] [10.1016/j.ejmech.2021.113750]

Source