6-(4-Methoxypheny0-2,2-dioxo-2,8-dihydropyrano[2,3-f]-chromene-3,9-dicarboxylic Acid

ID: ALA4856506

PubChem CID: 154634332

Max Phase: Preclinical

Molecular Formula: C21H12O9

Molecular Weight: 408.32

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc3cc(C(=O)O)c(=O)oc3c3cc(C(=O)O)c(=O)oc23)cc1

Standard InChI:  InChI=1S/C21H12O9/c1-28-11-4-2-9(3-5-11)12-6-10-7-14(18(22)23)20(26)29-16(10)13-8-15(19(24)25)21(27)30-17(12)13/h2-8H,1H3,(H,22,23)(H,24,25)

Standard InChI Key:  CNONOFMPWKREIC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   13.8287  -14.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5406  -13.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5424  -15.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8305  -15.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1208  -15.5440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1167  -16.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8285  -16.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5444  -16.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2560  -14.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2548  -15.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9678  -15.5471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6865  -15.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6877  -14.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9701  -13.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4007  -16.7764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3999  -15.5507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4032  -13.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1167  -14.3102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4053  -13.0709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8266  -17.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1106  -18.0183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5396  -18.0230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1146  -13.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1142  -13.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3997  -12.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6850  -13.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6894  -13.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4045  -14.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9691  -12.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9663  -11.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  3 10  2  0
  9  2  2  0
  2  1  1  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
  6 15  2  0
 12 16  2  0
 17 18  1  0
 17 19  2  0
 13 17  1  0
 20 21  1  0
 20 22  2  0
  7 20  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  1 23  1  0
 26 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856506

    ---

Associated Targets(Human)

GPR35 Tchem G-protein coupled receptor 35 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CHRM3 Tclin Muscarinic acetylcholine receptor M3 (7750 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD2 Tclin Dopamine D2 receptor (23596 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HRH3 Tclin Histamine H3 receptor (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.32Molecular Weight (Monoisotopic): 408.0481AlogP: 2.97#Rotatable Bonds: 4
Polar Surface Area: 144.25Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.45CX Basic pKa: CX LogP: 2.26CX LogD: -4.72
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: 0.16

References

1. Wei L, Hou T, Li J, Zhang X, Zhou H, Wang Z, Cheng J, Xiang K, Wang J, Zhao Y, Liang X..  (2021)  Structure-Activity Relationship Studies of Coumarin-like Diacid Derivatives as Human G Protein-Coupled Receptor-35 (hGPR35) Agonists and a Consequent New Design Principle.,  64  (5.0): [PMID:33630609] [10.1021/acs.jmedchem.0c01624]

Source