2-(3,4-dichlorophenyl)-3-hydroxy-9-(pyridin-4-ylmethyl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one

ID: ALA4856517

PubChem CID: 164613021

Max Phase: Preclinical

Molecular Formula: C23H16Cl2N2O4

Molecular Weight: 455.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1c(O)c(-c2ccc(Cl)c(Cl)c2)oc2c3c(ccc12)OCN(Cc1ccncc1)C3

Standard InChI:  InChI=1S/C23H16Cl2N2O4/c24-17-3-1-14(9-18(17)25)22-21(29)20(28)15-2-4-19-16(23(15)31-22)11-27(12-30-19)10-13-5-7-26-8-6-13/h1-9,29H,10-12H2

Standard InChI Key:  OIDMFEBULRWOIO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   28.7072  -15.3415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4226  -15.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1369  -14.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1357  -15.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8493  -15.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5687  -15.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5698  -14.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8516  -14.0937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8470  -16.5780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2826  -15.7558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2841  -14.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9985  -14.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7141  -14.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7165  -13.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9974  -12.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2847  -13.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7083  -14.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4222  -14.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4230  -13.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7114  -12.8683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9975  -13.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9951  -14.1053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7171  -12.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9965  -12.0426    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.0048  -11.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4322  -12.8706    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.0130  -10.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3015  -10.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5825  -10.7947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5796  -11.6248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2917  -12.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17  1  2  0
  1  2  1  0
  2  4  2  0
  3 18  2  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  5  9  2  0
  6 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 11  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 15 24  1  0
 23 25  1  0
 14 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856517

    ---

Associated Targets(Human)

RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.30Molecular Weight (Monoisotopic): 454.0487AlogP: 5.22#Rotatable Bonds: 3
Polar Surface Area: 75.80Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.55CX Basic pKa: 4.28CX LogP: 4.16CX LogD: 4.13
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -0.47

References

1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P..  (2021)  Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment.,  64  (20.0): [PMID:34644502] [10.1021/acs.jmedchem.1c00087]

Source