2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(4-fluorophenyl)acetamide

ID: ALA4856551

PubChem CID: 164614103

Max Phase: Preclinical

Molecular Formula: C22H15FI2N4O4S2

Molecular Weight: 736.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccc(F)cc3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C22H15FI2N4O4S2/c23-12-1-3-14(4-2-12)27-19(30)11-34-22-28-20-17(9-13(24)10-18(20)25)21(31)29(22)15-5-7-16(8-6-15)35(26,32)33/h1-10H,11H2,(H,27,30)(H2,26,32,33)

Standard InChI Key:  IXPSTVOITSCPEE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   19.6208   -8.7002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0336   -9.4101    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.4420   -8.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3613  -11.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3602  -11.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0682  -12.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0664  -10.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7751  -11.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7739  -11.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4840  -12.2691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1998  -11.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2010  -11.0346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4864  -10.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6535  -10.6277    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   15.0679  -13.0819    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   16.4864   -9.8015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9080  -10.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6150  -11.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3232  -10.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3257   -9.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6140   -9.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9087   -9.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9064  -12.2704    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7411   -9.8197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6152  -11.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3218  -12.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0306  -11.8678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3195  -13.0916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7372  -12.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7302  -13.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4359  -13.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1457  -13.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1454  -12.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4391  -11.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8528  -13.5061    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856551

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 736.33Molecular Weight (Monoisotopic): 735.8608AlogP: 4.11#Rotatable Bonds: 6
Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: CX LogP: 5.24CX LogD: 5.24
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.31

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source