The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-6-(3-(4-acetoxyphenyl)acryloyl)-7-methoxy-2,2-dimethylchroman-5-yl acrylate ID: ALA4856587
PubChem CID: 164609754
Max Phase: Preclinical
Molecular Formula: C26H26O7
Molecular Weight: 450.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Oc1c2c(cc(OC)c1C(=O)/C=C/c1ccc(OC(C)=O)cc1)OC(C)(C)CC2
Standard InChI: InChI=1S/C26H26O7/c1-6-23(29)32-25-19-13-14-26(3,4)33-21(19)15-22(30-5)24(25)20(28)12-9-17-7-10-18(11-8-17)31-16(2)27/h6-12,15H,1,13-14H2,2-5H3/b12-9+
Standard InChI Key: UTVYLSGVJDAYGN-FMIVXFBMSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
0.7718 -10.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5642 -10.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9857 -10.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5642 -11.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2695 -11.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2695 -10.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9748 -10.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9732 -11.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6774 -11.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3837 -11.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3813 -10.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6765 -10.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0918 -11.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0926 -12.6767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7991 -11.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -11.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2145 -11.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9187 -11.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6255 -11.4491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6252 -10.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9121 -10.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2082 -10.6343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0877 -10.2222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0851 -9.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6767 -12.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3319 -10.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0406 -10.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7473 -10.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0425 -11.4449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9687 -13.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2613 -12.6746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9680 -13.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2600 -14.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
2 4 1 0
2 6 1 0
4 5 1 0
5 8 1 0
7 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 1 0
23 24 1 0
9 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
25 30 1 0
30 31 2 0
30 32 1 0
32 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.49Molecular Weight (Monoisotopic): 450.1679AlogP: 4.71#Rotatable Bonds: 7Polar Surface Area: 88.13Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.96CX LogD: 4.96Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: 1.05
References 1. Ajiaikebaier D, Li Z, Lin T, Sun X, Wang B, Li J.. (2021) Synthesis of pyranochalcone derivatives and their inhibitory effect on NF-κB activation., 42 [PMID:33862226 ] [10.1016/j.bmcl.2021.128042 ]