The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((2-Hydroxy-6-methoxyquinolin-3-yl)methylene)amino)-3-thioxo-6-(3,4,5-trimethoxybenzyl)-3,4-dihydro-1,2,4-triazin-5(2H)-one ID: ALA4856646
PubChem CID: 164613030
Max Phase: Preclinical
Molecular Formula: C24H23N5O6S
Molecular Weight: 509.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(O)c(/C=N/n3c(=S)[nH]nc(Cc4cc(OC)c(OC)c(OC)c4)c3=O)cc2c1
Standard InChI: InChI=1S/C24H23N5O6S/c1-32-16-5-6-17-14(11-16)10-15(22(30)26-17)12-25-29-23(31)18(27-28-24(29)36)7-13-8-19(33-2)21(35-4)20(9-13)34-3/h5-6,8-12H,7H2,1-4H3,(H,26,30)(H,28,36)/b25-12+
Standard InChI Key: KOGLCIMBIYSRMX-BRJLIKDPSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
33.5117 -22.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5105 -23.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2186 -24.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2168 -22.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9254 -22.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9262 -23.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6347 -24.2070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3430 -23.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3382 -22.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6291 -22.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0434 -22.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7536 -22.9654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4588 -22.5525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1669 -22.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8700 -22.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8692 -21.7325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1592 -21.3261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4499 -21.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7396 -21.3330 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.1692 -23.7767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5786 -22.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2854 -22.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9899 -22.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6961 -22.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6947 -21.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9811 -21.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2777 -21.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0523 -24.2020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.9763 -20.5038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6816 -20.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4009 -21.3166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.1101 -21.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4046 -22.9532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.4061 -23.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8039 -22.5761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8037 -21.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
14 20 2 0
15 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
8 28 1 0
26 29 1 0
29 30 1 0
25 31 1 0
31 32 1 0
24 33 1 0
33 34 1 0
1 35 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.54Molecular Weight (Monoisotopic): 509.1369AlogP: 3.06#Rotatable Bonds: 8Polar Surface Area: 133.08Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.36CX Basic pKa: 1.37CX LogP: 3.82CX LogD: 3.55Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -0.85
References 1. Ghanim AM, Rezq S, Ibrahim TS, Romero DG, Kothayer H.. (2021) Novel 1,2,4-triazine-quinoline hybrids: The privileged scaffolds as potent multi-target inhibitors of LPS-induced inflammatory response via dual COX-2 and 15-LOX inhibition., 219 [PMID:33892270 ] [10.1016/j.ejmech.2021.113457 ]