The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Talaromynoid G ID: ALA4856726
PubChem CID: 164610304
Max Phase: Preclinical
Molecular Formula: C26H32O10
Molecular Weight: 504.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@]12[C@@H]3[C@@H](O)O[C@@H](C)[C@@]14OC(=O)[C@]3(C)C[C@H]1C(C)=C3CC(=O)OC(C)(C)[C@@]35O[C@H]5[C@H](O4)[C@@]12C
Standard InChI: InChI=1S/C26H32O10/c1-10-12-8-14(27)33-21(3,4)25(12)17(34-25)16-23(6)13(10)9-22(5)15-18(28)32-11(2)26(35-16,36-19(22)29)24(15,23)20(30)31-7/h11,13,15-18,28H,8-9H2,1-7H3/t11-,13-,15+,16-,17-,18-,22+,23+,24-,25+,26+/m0/s1
Standard InChI Key: GZYBWPICWOFNSA-IFJGHQLMSA-N
Molfile:
RDKit 2D
40 46 0 0 0 0 0 0 0 0999 V2000
10.5987 -16.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6029 -15.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8931 -15.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4216 -13.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8586 -15.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6770 -15.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1293 -14.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2394 -15.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7691 -13.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5239 -14.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3839 -15.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2555 -13.8717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6314 -15.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9874 -15.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0963 -16.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8485 -16.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4925 -16.1392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5745 -16.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9630 -17.2955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2227 -17.4192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9573 -17.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4904 -13.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4029 -13.0679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7696 -14.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1246 -13.5951 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.5196 -13.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9211 -14.6145 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.0403 -15.9022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1122 -16.5502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8114 -14.4577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1159 -18.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6429 -16.5337 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.4601 -15.0231 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.4054 -15.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6537 -14.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1037 -13.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3023 -13.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0539 -14.6406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7523 -13.2541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0879 -14.9158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
35 4 2 0
34 5 1 0
4 7 1 0
5 6 1 0
6 8 1 0
7 8 1 0
7 9 1 0
8 14 1 0
10 9 1 0
10 13 1 0
13 11 1 0
30 12 1 0
12 10 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 11 1 0
14 18 1 6
18 19 2 0
18 20 1 0
16 21 1 1
4 22 1 0
12 23 2 0
8 24 1 6
7 25 1 1
10 26 1 6
13 27 1 6
34 28 1 6
5 28 1 0
6 29 1 0
15 29 1 0
15 30 1 1
20 31 1 0
5 32 1 1
6 33 1 6
34 35 1 0
34 2 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 2 1 0
37 39 2 0
11 40 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.53Molecular Weight (Monoisotopic): 504.1995AlogP: 1.38#Rotatable Bonds: 1Polar Surface Area: 130.12Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.09CX Basic pKa: ┄CX LogP: 1.65CX LogD: 1.65Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: 2.17
References 1. Huang ZH, Liang X, Li CJ, Gu Q, Ma X, Qi SH.. (2021) Talaromynoids A-I, Highly Oxygenated Meroterpenoids from the Marine-Derived Fungus Talaromyces purpureogenus SCSIO 41517 and Their Lipid Accumulation Inhibitory Activities., 84 (10.0): [PMID:34596414 ] [10.1021/acs.jnatprod.1c00681 ]