Podospin L

ID: ALA4856742

PubChem CID: 99698869

Max Phase: Preclinical

Molecular Formula: C19H24O7

Molecular Weight: 364.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)/C=C/C[C@@H](O)[C@@H](O)C(=O)CCC[C@H](C)OC2=O

Standard InChI:  InChI=1S/C19H24O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h4,6,9-11,15,18,21-23H,3,5,7-8H2,1-2H3/b6-4+/t11-,15+,18-/m0/s1

Standard InChI Key:  WFIUAGOQGGAREU-APARVZKSSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   40.1439  -18.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1428  -19.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8576  -20.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8558  -18.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5712  -18.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5700  -19.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2830  -20.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2853  -18.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0028  -18.8898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.9993  -19.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4310  -18.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7163  -18.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4274  -19.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7098  -20.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7024  -20.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4110  -21.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1287  -20.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1379  -20.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8533  -17.6537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4281  -20.1307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7139  -19.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4024  -22.1932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2853  -17.6472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.7186  -17.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8390  -21.3821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.9837  -21.3530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  2  0
  9  8  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  4 19  1  0
  2 20  1  0
 20 21  1  0
 16 22  1  6
  8 23  2  0
 12 24  1  1
 17 25  2  0
 15 26  1  6
M  END

Associated Targets(non-human)

Splenocyte (1641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.39Molecular Weight (Monoisotopic): 364.1522AlogP: 1.82#Rotatable Bonds: 1
Polar Surface Area: 113.29Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.59CX Basic pKa: CX LogP: 2.57CX LogD: 2.57
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: 1.85

References

1. Gao Y, Duan FF, Liu L, Peng XG, Meng XG, Ruan HL..  (2021)  Hypothemycin-Type Resorcylic Acid Lactones with Immunosuppressive Activities from a Podospora sp.,  84  (2.0): [PMID:33544615] [10.1021/acs.jnatprod.0c01344]

Source