The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(2-(1-hydroxy-4-methyl-2-phenyl-1H-imidazole-5-carboxamido)-3-phenylpropanamido)benzoic acid ID: ALA4856757
PubChem CID: 164611907
Max Phase: Preclinical
Molecular Formula: C27H24N4O5
Molecular Weight: 484.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(-c2ccccc2)n(O)c1C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1
Standard InChI: InChI=1S/C27H24N4O5/c1-17-23(31(36)24(28-17)19-10-6-3-7-11-19)26(33)30-22(16-18-8-4-2-5-9-18)25(32)29-21-14-12-20(13-15-21)27(34)35/h2-15,22,36H,16H2,1H3,(H,29,32)(H,30,33)(H,34,35)/t22-/m0/s1
Standard InChI Key: TWIOTLCGPUGEGI-QFIPXVFZSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
37.9416 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6493 -10.5162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3570 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3545 -11.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0614 -12.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7701 -11.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7674 -10.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0600 -10.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4783 -12.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4794 -12.9677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1855 -11.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2339 -10.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5262 -10.9248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8185 -10.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9416 -11.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2339 -9.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9416 -9.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6489 -9.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3561 -9.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3565 -8.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6439 -8.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9395 -8.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8185 -9.6990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1108 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3629 -10.5968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8161 -11.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2247 -11.9118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0240 -11.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6310 -12.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1908 -9.7979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0081 -11.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6765 -10.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8646 -10.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3834 -10.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7199 -11.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5309 -11.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
9 11 1 0
1 12 1 0
12 13 1 0
13 14 1 0
1 15 2 0
12 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 23 2 0
14 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 2 0
28 29 1 0
25 30 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
26 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.51Molecular Weight (Monoisotopic): 484.1747AlogP: 3.77#Rotatable Bonds: 8Polar Surface Area: 133.55Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.18CX Basic pKa: 2.80CX LogP: 2.89CX LogD: 0.06Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.85
References 1. Lei Y, Zhang B, Zhang Y, Dai X, Duan Y, Mao Q, Gao J, Yang Y, Bao Z, Fu X, Ping K, Yan C, Mou Y, Wang S.. (2021) Design, synthesis and biological evaluation of novel FXIa inhibitors with 2-phenyl-1H-imidazole-5-carboxamide moiety as P1 fragment., 220 [PMID:33894565 ] [10.1016/j.ejmech.2021.113437 ]