7-((4-Hydroxyphenyl)amino)-1-isopentyl-4,4-dimethy1-1,4-dihydro-2H-pyrimido[4,5-d][1,3]oxazin-2-one

ID: ALA4856762

PubChem CID: 164611910

Max Phase: Preclinical

Molecular Formula: C20H26N4O3

Molecular Weight: 370.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CCN1C(=O)OC(C(C)C)c2cnc(Nc3ccc(O)cc3)nc21

Standard InChI:  InChI=1S/C20H26N4O3/c1-12(2)9-10-24-18-16(17(13(3)4)27-20(24)26)11-21-19(23-18)22-14-5-7-15(25)8-6-14/h5-8,11-13,17,25H,9-10H2,1-4H3,(H,21,22,23)

Standard InChI Key:  QWHONHLOGLNYCP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   20.2771  -10.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1584  -11.3003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1572  -12.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8653  -12.5288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8635  -10.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5721  -11.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5755  -12.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2879  -12.5293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0014  -12.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9981  -11.2909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4492  -12.5279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4486  -13.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7425  -13.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7415  -14.5716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4494  -14.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1598  -14.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1573  -13.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7103  -12.5227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2901  -13.3465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9989  -13.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0011  -14.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7100  -14.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2946  -14.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2706  -10.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9750   -9.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5596   -9.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4498  -15.7987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  1  1  0
  3 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  9 18  2  0
  8 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
  1 24  1  0
 24 25  1  0
 24 26  1  0
 15 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4856762

    ---

Associated Targets(Human)

RPS6KA6 Tchem Ribosomal protein S6 kinase alpha 6 (2027 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.45Molecular Weight (Monoisotopic): 370.2005AlogP: 4.63#Rotatable Bonds: 6
Polar Surface Area: 87.58Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.23CX Basic pKa: 2.00CX LogP: 4.85CX LogD: 4.85
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -0.41

References

1. Yuan Y, Xu J, Jiang L, Yu K, Ge Y, Li M, He H, Niu Q, Shi X, Fan L, Chen Z, Zhao Z, Li S, Xu Y, Wang Z, Li H..  (2021)  Discovery, Optimization, and Structure-Activity Relationship Study of Novel and Potent RSK4 Inhibitors as Promising Agents for the Treatment of Esophageal Squamous Cell Carcinoma.,  64  (18.0): [PMID:34496560] [10.1021/acs.jmedchem.1c00969]

Source