5-(5-((5-fluoro-2,3-dihydrobenzofuran-4-yl)methylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl)-5-azaspiro[2.4]heptan-6-one

ID: ALA4856933

PubChem CID: 164611401

Max Phase: Preclinical

Molecular Formula: C20H19FN6O2

Molecular Weight: 394.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CC2(CC2)CN1c1cnc(NCc2c(F)ccc3c2CCO3)n2cnnc12

Standard InChI:  InChI=1S/C20H19FN6O2/c21-14-1-2-16-12(3-6-29-16)13(14)8-22-19-23-9-15(18-25-24-11-27(18)19)26-10-20(4-5-20)7-17(26)28/h1-2,9,11H,3-8,10H2,(H,22,23)

Standard InChI Key:  UWOLLTNLUAOGPM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 34  0  0  0  0  0  0  0  0999 V2000
    7.2804  -23.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4950  -22.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7051  -22.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1938  -19.4392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1938  -20.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8990  -20.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8990  -19.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6043  -19.4392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6088  -20.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3840  -20.5001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8587  -19.8392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3768  -19.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8990  -18.2093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6067  -17.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6067  -16.9835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6096  -15.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8995  -15.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9027  -16.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3178  -15.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3164  -16.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0899  -16.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5695  -16.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0923  -15.5116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1965  -16.9915    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8988  -21.4769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2435  -21.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3115  -22.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5637  -21.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3406  -21.7035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
  4  7  2  0
  5  6  2  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
  7 13  1  0
 13 14  1  0
 14 15  1  0
 15 20  2  0
 19 16  2  0
 16 17  1  0
 17 18  2  0
 18 15  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 18 24  1  0
  6 25  1  0
 25 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  1  0
 28 25  1  0
 28 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4856933

    ---

Associated Targets(Human)

EED Tchem Polycomb protein EED (645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KARPAS-422 (454 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.41Molecular Weight (Monoisotopic): 394.1554AlogP: 2.33#Rotatable Bonds: 4
Polar Surface Area: 84.65Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.42CX LogP: 0.12CX LogD: 0.12
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: -0.90

References

1. Bagal SK, Gregson C, O' Donovan DH, Pike KG, Bloecher A, Barton P, Borodovsky A, Code E, Fillery SM, Hsu JH, Kawatkar SP, Li C, Longmire D, Nai Y, Nash SC, Pike A, Robinson J, Read JA, Rawlins PB, Shen M, Tang J, Wang P, Woods H, Williamson B..  (2021)  Diverse, Potent, and Efficacious Inhibitors That Target the EED Subunit of the Polycomb Repressive Complex 2 Methyltransferase.,  64  (23.0): [PMID:34807608] [10.1021/acs.jmedchem.1c01161]

Source