(R)-(3,4-difluoro-5-methoxyphenyl)((4aR,5S)-1-(4-methoxyphenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)methanol

ID: ALA4857046

PubChem CID: 164614680

Max Phase: Preclinical

Molecular Formula: C26H26F2N2O3

Molecular Weight: 452.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@H](O)c4cc(F)c(F)c(OC)c4)C2C3)cc1

Standard InChI:  InChI=1S/C26H26F2N2O3/c1-32-19-8-6-18(7-9-19)30-23-12-15-4-3-5-20(21(15)10-17(23)14-29-30)26(31)16-11-22(27)25(28)24(13-16)33-2/h6-9,11-14,20-21,26,31H,3-5,10H2,1-2H3/t20-,21?,26-/m0/s1

Standard InChI Key:  QAGAGBQKNPFAEQ-ZYOOMIPPSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   25.1671  -15.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8811  -15.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8811  -14.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1671  -13.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4530  -15.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4555  -14.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7429  -13.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7419  -15.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0288  -15.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0277  -14.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2432  -13.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7623  -14.5947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2452  -15.2614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9960  -16.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1861  -16.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9329  -17.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4846  -17.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2967  -17.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5501  -16.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1656  -12.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8814  -12.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4484  -12.5227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9611  -13.5435    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.2308  -18.4026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5939  -12.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3093  -12.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3103  -11.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5901  -11.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8777  -11.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0211  -12.9351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.0225  -11.2842    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.5879  -10.4598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2991  -10.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4263  -18.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  8  5  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 14  1  0
  4 20  1  0
 20 21  1  0
 20 22  1  1
  4 23  1  6
 17 24  1  0
 21 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 21  1  0
 26 30  1  0
 27 31  1  0
 28 32  1  0
 32 33  1  0
 24 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857046

    ---

Associated Targets(non-human)

Nr3c1 Glucocorticoid receptor (1330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.50Molecular Weight (Monoisotopic): 452.1911AlogP: 5.26#Rotatable Bonds: 5
Polar Surface Area: 56.51Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.61CX LogP: 4.79CX LogD: 4.79
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -0.22

References

1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR..  (2021)  Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion.,  12  (10.0): [PMID:34676039] [10.1021/acsmedchemlett.1c00379]

Source