N-(2'-chloro-5'-(trifluoromethyl)-[1,1'-biphenyl]-4-yl)-2,6-difluorobenzamide

ID: ALA4857063

PubChem CID: 11418465

Max Phase: Preclinical

Molecular Formula: C20H11ClF5NO

Molecular Weight: 411.76

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2cc(C(F)(F)F)ccc2Cl)cc1)c1c(F)cccc1F

Standard InChI:  InChI=1S/C20H11ClF5NO/c21-15-9-6-12(20(24,25)26)10-14(15)11-4-7-13(8-5-11)27-19(28)18-16(22)2-1-3-17(18)23/h1-10H,(H,27,28)

Standard InChI Key:  OHHIGBIGGBDEJY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   10.5852   -7.8881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.1785   -7.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7673   -7.8855    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.3193   -5.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6084   -9.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0348   -5.5341    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.8924   -6.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0348   -7.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0348   -8.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8971   -7.1847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8971   -9.6605    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.3193   -6.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3239   -7.1847    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.8971   -8.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6038   -5.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8924   -5.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1773   -8.4205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6038   -7.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0353   -9.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6084   -8.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3239   -9.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0353   -8.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4618   -8.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4618   -7.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7462   -8.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7462   -6.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3239   -8.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4694   -6.7670    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 19 22  2  0
 24 26  2  0
 14 20  1  0
 26  8  1  0
 16  7  2  0
 14 17  1  0
 20  5  1  0
 22 27  1  0
 23 25  2  0
  5 21  2  0
  4 15  2  0
 12  4  1  0
 20 27  2  0
 14 10  2  0
 25  9  1  0
  8 12  1  0
 15 16  1  0
  4  6  1  0
 17 23  1  0
  7 18  1  0
 23 24  1  0
 21 19  1  0
  8  9  2  0
 12 18  2  0
 27 13  1  0
  5 11  1  0
  7  2  1  0
  2 28  1  0
M  END

Associated Targets(Human)

IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.76Molecular Weight (Monoisotopic): 411.0449AlogP: 6.56#Rotatable Bonds: 3
Polar Surface Area: 29.10Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.55CX Basic pKa: CX LogP: 6.48CX LogD: 6.48
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: -1.56

References

1. Khedkar NR, Irlapatti NR, Dadke D, Kanoje V, Shaikh Z, Karche V, Shinde V, Deshmukh G, Patil A, Jachak S, Phukan S, Kizhakinagath PA, Gholve M, Bhankhede T, Daler J, Nemade HN, Budhe S, Pareek H, Yeshodharan R, Gupta R, Kalia A, Pandey D, Wagh A, Kumar S, Patil V, Modi D, Sharma N, Ahirrao P, Mehta M, Kumar H, Nigade P, Tamane K, Mallurwar S, Kuldharan S, Pawar S, Vishwase G, Bokan S, Singh M, Naik K, Ingawale S, Shankar R, Kamalakannan P, Venugopal S, George SK, Padiya KJ, Nemmani KVS, Gundu J, Bhonde M, Narasimham L, Sindkhedkar M, Shah C, Sinha N, Sharma S, Bakhle D, Kamboj RK, Palle VP..  (2021)  Discovery of a Novel Potent and Selective Calcium Release-Activated Calcium Channel Inhibitor: 2,6-Difluoro-N-(2'-methyl-3'-(4-methyl-5-oxo-4,5-dihydro-1,3,4-oxadiazol-2-yl)-[1,1'-biphenyl]-4-yl)benzamide. Structure-Activity Relationship and Preclinical Characterization.,  64  (23.0): [PMID:34843241] [10.1021/acs.jmedchem.1c01403]

Source