The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((5-chloro-2-((2-chloro-4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)propionamide ID: ALA4857066
PubChem CID: 164615213
Max Phase: Preclinical
Molecular Formula: C24H26Cl2N6O2
Molecular Weight: 501.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3Cl)ncc2Cl)c1
Standard InChI: InChI=1S/C24H26Cl2N6O2/c1-3-22(33)28-16-5-4-6-18(13-16)34-23-20(26)15-27-24(30-23)29-21-8-7-17(14-19(21)25)32-11-9-31(2)10-12-32/h4-8,13-15H,3,9-12H2,1-2H3,(H,28,33)(H,27,29,30)
Standard InChI Key: HHLDCNJLWHHJKL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
6.5196 -18.6715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5185 -19.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2265 -19.9000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9362 -19.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9333 -18.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2247 -18.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8104 -19.8991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1030 -19.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6445 -19.8981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3516 -19.4884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1082 -18.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4017 -18.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6927 -18.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6946 -19.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4018 -19.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0566 -19.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7632 -19.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7623 -18.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0490 -18.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3454 -18.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4713 -19.8951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1786 -19.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8868 -19.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5940 -19.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1777 -18.6686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9847 -18.2637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9843 -17.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2773 -18.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5693 -18.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2764 -17.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5689 -17.4473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8610 -17.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4047 -20.7159 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6395 -18.2567 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
8 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 8 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
17 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 2 0
13 26 1 0
26 27 1 0
26 28 1 0
28 29 1 0
27 30 1 0
29 31 1 0
31 30 1 0
31 32 1 0
15 33 1 0
5 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.42Molecular Weight (Monoisotopic): 500.1494AlogP: 5.42#Rotatable Bonds: 7Polar Surface Area: 82.62Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.83CX Basic pKa: 7.83CX LogP: 5.36CX LogD: 4.80Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -1.92
References 1. Yang H, Wang X, Wang C, Yin F, Qu L, Shi C, Zhao J, Li S, Ji L, Peng W, Luo H, Cheng M, Kong L.. (2021) Optimization of WZ4003 as NUAK inhibitors against human colorectal cancer., 210 [PMID:33310286 ] [10.1016/j.ejmech.2020.113080 ]