The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(4-hydroxy-3-methoxyphenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione ID: ALA4857084
Cas Number: 372499-75-7
PubChem CID: 2889578
Max Phase: Preclinical
Molecular Formula: C23H19NO4
Molecular Weight: 373.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc23)ccc1O
Standard InChI: InChI=1S/C23H19NO4/c1-28-18-11-12(9-10-16(18)25)19-20-15(7-4-8-17(20)26)24-22-13-5-2-3-6-14(13)23(27)21(19)22/h2-3,5-6,9-11,19,24-25H,4,7-8H2,1H3
Standard InChI Key: FNVGSOFWHKUKOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
5.9261 -12.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9261 -10.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6388 -10.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6353 -11.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3448 -12.0499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0622 -11.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0658 -10.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3517 -10.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2133 -11.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2134 -10.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4281 -11.8914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9426 -11.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4286 -10.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0943 -9.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2742 -9.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7897 -10.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1267 -11.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9261 -12.8691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2097 -13.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2102 -14.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9264 -14.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6435 -14.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6394 -13.2784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3401 -12.8757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1728 -12.6767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4954 -14.5206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7799 -14.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9284 -15.3461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 2 1 0
9 1 1 0
1 4 1 0
3 2 1 0
3 4 2 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 10 2 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
1 18 1 0
5 24 2 0
11 25 2 0
20 26 1 0
26 27 1 0
21 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 373.41Molecular Weight (Monoisotopic): 373.1314AlogP: 3.70#Rotatable Bonds: 2Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.93CX Basic pKa: ┄CX LogP: 2.45CX LogD: 2.45Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.84Np Likeness Score: -0.11
References 1. (2020) Inhibitors of GPR174 and Uses Thereof, 2. (2020) Methods and Compositions for Treating Cancer,