2-(5-(4-(1-(6,7,10-trioxaspiro[4.5]decan-8-yl)vinyl)phenoxy)naphthalen-1-yloxy)ethanol

ID: ALA4857093

PubChem CID: 44233048

Max Phase: Preclinical

Molecular Formula: C27H28O6

Molecular Weight: 448.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2cccc3c(OCCO)cccc23)cc1)C1COC2(CCCC2)OO1

Standard InChI:  InChI=1S/C27H28O6/c1-19(26-18-30-27(33-32-26)14-2-3-15-27)20-10-12-21(13-11-20)31-25-9-5-6-22-23(25)7-4-8-24(22)29-17-16-28/h4-13,26,28H,1-3,14-18H2

Standard InChI Key:  IIGDDBUMDWHWDQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   25.5519   -2.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3402   -2.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7840   -1.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2700   -1.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5085   -1.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6006   -1.9209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3107   -2.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3111   -3.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0204   -3.5461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7266   -3.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7190   -2.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0091   -1.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4374   -3.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4434   -4.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1420   -3.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8492   -3.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5518   -3.1183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8394   -1.8952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1306   -2.3072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8954   -2.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4881   -3.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2032   -3.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9050   -3.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4835   -2.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1899   -1.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1876   -1.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4798   -0.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7727   -1.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7784   -1.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0732   -2.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3630   -1.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6578   -2.3565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9477   -1.9521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 15 19  1  0
 16 17  1  0
 17  1  1  0
  1 18  1  0
 18 19  1  0
  6 20  1  0
 20 25  2  0
 24 21  2  0
 21 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1886AlogP: 5.63#Rotatable Bonds: 7
Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.44CX LogD: 5.44
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: 0.37

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source