2-(2-(benzylthio)-6-(4-fluorophenyl)pyrimidin-4-yl)-1H-benzo[d]imidazole

ID: ALA4857121

PubChem CID: 164610320

Max Phase: Preclinical

Molecular Formula: C24H17FN4S

Molecular Weight: 412.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1ccc(-c2cc(-c3nc4ccccc4[nH]3)nc(SCc3ccccc3)n2)cc1

Standard InChI:  InChI=1S/C24H17FN4S/c25-18-12-10-17(11-13-18)21-14-22(23-26-19-8-4-5-9-20(19)27-23)29-24(28-21)30-15-16-6-2-1-3-7-16/h1-14H,15H2,(H,26,27)

Standard InChI Key:  XPGGKTZQPYIHOQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    4.8935  -19.1544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8923  -19.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6004  -20.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3100  -19.9735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3072  -19.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5986  -18.7456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1888  -20.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4426  -20.0482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1028  -21.1937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0149  -20.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0148  -21.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7223  -21.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4304  -21.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4265  -20.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7184  -19.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3033  -21.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8958  -20.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0805  -20.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6718  -21.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0843  -22.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8983  -22.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5961  -17.9284    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.3026  -17.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1393  -21.6027    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0116  -17.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0118  -18.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7199  -19.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4274  -18.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4223  -17.9129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7137  -17.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 17  1  0
 16  9  1  0
  9  7  1  0
  2  7  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  6 22  1  0
 22 23  1  0
 13 24  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857121

    ---

Associated Targets(non-human)

Botrytis cinerea (4183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Sclerotinia sclerotiorum (877 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.49Molecular Weight (Monoisotopic): 412.1158AlogP: 6.12#Rotatable Bonds: 5
Polar Surface Area: 54.46Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.35CX Basic pKa: 2.37CX LogP: 6.85CX LogD: 6.85
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: -1.50

References

1. Sun C, Zhang S, Qian P, Li Y, Deng H, Ren W, Jiang L..  (2021)  Synthesis and fungicidal activity of novel 2-(2-alkylthio-6-phenylpyrimidin-4-yl)-1H-benzimidazoles.,  47  [PMID:34157391] [10.1016/j.bmcl.2021.128210]

Source