The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-(N-(2-(Benzylamino)-1-(1H-indol-3-yl)-2-oxoethyl)-2-chloroacetamido)benzoate ID: ALA4857142
PubChem CID: 164611406
Max Phase: Preclinical
Molecular Formula: C28H26ClN3O4
Molecular Weight: 503.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(N(C(=O)CCl)C(C(=O)NCc2ccccc2)c2c[nH]c3ccccc23)cc1
Standard InChI: InChI=1S/C28H26ClN3O4/c1-2-36-28(35)20-12-14-21(15-13-20)32(25(33)16-29)26(23-18-30-24-11-7-6-10-22(23)24)27(34)31-17-19-8-4-3-5-9-19/h3-15,18,26,30H,2,16-17H2,1H3,(H,31,34)
Standard InChI Key: UCVIZRHPYAZGGX-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
1.2900 -15.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2888 -16.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0035 -16.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0017 -15.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7170 -15.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7218 -16.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5136 -16.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9981 -15.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5056 -15.2487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7708 -17.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2203 -17.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4767 -18.7694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2840 -18.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8345 -18.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5776 -17.5383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1266 -16.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5416 -19.7240 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.9269 -19.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4129 -17.8205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -18.4944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9333 -17.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4820 -16.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2235 -15.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4112 -15.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8659 -16.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1195 -19.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7716 -15.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5795 -15.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1276 -14.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9354 -14.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5120 -14.2973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8603 -18.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0538 -18.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5030 -18.8805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7644 -19.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5704 -19.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
13 14 1 0
14 15 1 0
7 10 1 0
15 16 1 0
13 17 1 0
12 18 1 0
11 19 2 0
14 20 2 0
16 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 16 1 0
18 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
27 31 2 0
26 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.99Molecular Weight (Monoisotopic): 503.1612AlogP: 4.97#Rotatable Bonds: 9Polar Surface Area: 91.50Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.74CX Basic pKa: ┄CX LogP: 4.63CX LogD: 4.63Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.02
References 1. Xu C, Xiao Z, Wang J, Lai H, Zhang T, Guan Z, Xia M, Chen M, Ren L, He Y, Gao Y, Zhao C.. (2021) Discovery of a Potent Glutathione Peroxidase 4 Inhibitor as a Selective Ferroptosis Inducer., 64 (18.0): [PMID:34506134 ] [10.1021/acs.jmedchem.1c00569 ]